/* ATPR · paginile publice — stil editorial: negru adanc, linii fine, rosu ATPR, tipografie mare.
   Fara colturi rotunjite si fara „casute”. Fonturile (Anton, Inter) sunt in assets/fonts. */
:root {
  --bk: #0a0a0a; --bk2: #111111; --bk3: #161616; --ln: #262626; --ln2: #3a3a3a;
  --wh: #f3f0eb; --wh2: #d6d2cc; --mu: #9a968f;
  --red: #c8102e; --red-d: #9e0b23; --red-t: #ff4d63; --ok: #7fd18a;
  --display: Anton, Impact, 'Arial Narrow', sans-serif;
  --text: Inter, system-ui, -apple-system, 'Segoe UI', Arial, sans-serif;
  --pad: 32px;
}
* { box-sizing: border-box; }
[hidden] { display: none !important; }
html { -webkit-text-size-adjust: 100%; }
body { margin: 0; background: var(--bk); color: var(--wh); font: 16px/1.6 var(--text); -webkit-font-smoothing: antialiased; }
/* derularea se blocheaza pe <html>, nu pe <body>: pe body, „overflow: hidden” strica bara de sus (sticky) si meniul de pe telefon iesea din ecran */
html:has(> body.menu-open) { overflow: hidden; }
a { color: var(--wh); text-decoration-color: var(--red); text-underline-offset: 3px; }
a:hover { color: #fff; text-decoration-color: var(--red-t); }
img { max-width: 100%; }
::selection { background: var(--red); color: #fff; }
.skip { position: absolute; left: -9999px; top: 0; background: var(--red); color: #fff; padding: 10px 16px; z-index: 100; }
.skip:focus { left: 10px; top: 10px; }
.d, h1, .title h1 { font-family: var(--display); font-weight: 400; text-transform: uppercase; letter-spacing: .01em; line-height: 1.04; }
.lbl, .k { font-size: 11px; font-weight: 600; letter-spacing: .2em; text-transform: uppercase; color: var(--mu); }
.out { color: transparent; -webkit-text-stroke: 1.5px var(--wh); }
:focus-visible { outline: 2px solid var(--red-t); outline-offset: 3px; }
/* textura fina (granulatie) si aparitia discreta la derulare */
:root { --ease: cubic-bezier(.2,.7,.2,1); }
body::after { content: ""; position: fixed; inset: 0; z-index: 90; pointer-events: none; opacity: .045; mix-blend-mode: overlay;
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='160' height='160'%3E%3Cfilter id='n'%3E%3CfeTurbulence type='fractalNoise' baseFrequency='.9' numOctaves='2'/%3E%3C/filter%3E%3Crect width='100%25' height='100%25' filter='url(%23n)'/%3E%3C/svg%3E"); }
html { overflow-x: clip; }
.js .rv { opacity: 0; transform: translateY(26px); transition: opacity .9s var(--ease), transform .9s var(--ease); animation: rv-safe 0s 2.5s forwards; }
.js .rv.in { opacity: 1; transform: none; animation: none; }
.js .rv.d1 { transition-delay: .08s; } .js .rv.d2 { transition-delay: .16s; } .js .rv.d3 { transition-delay: .24s; }
@keyframes rv-safe { to { opacity: 1; transform: none; } } /* daca scriptul nu ruleaza, totul apare oricum */

/* ---------- antet ---------- */
.top { position: sticky; top: 0; z-index: 40; background: rgba(10,10,10,.92); backdrop-filter: blur(12px); -webkit-backdrop-filter: blur(12px); border-bottom: 1px solid var(--ln); transition: background .4s, border-color .4s; }
.is-home .top { position: fixed; left: 0; right: 0; background: linear-gradient(rgba(10,10,10,.7), rgba(10,10,10,0)); border-color: transparent; backdrop-filter: none; -webkit-backdrop-filter: none; }
.is-home .top.solid, .is-home.menu-open .top { background: rgba(10,10,10,.94); backdrop-filter: blur(12px); -webkit-backdrop-filter: blur(12px); border-color: var(--ln); }
.top__in { height: 72px; padding: 0 0 0 var(--pad); display: flex; align-items: stretch; }
.top__logo { display: flex; align-items: center; padding-right: 26px; }
.top__logo img { height: 42px; width: auto; }
.mnav { display: flex; margin-left: auto; }
.mnav__m { display: none; }
.nav__item { position: relative; display: flex; }
.nav__item > a { position: relative; display: flex; align-items: center; gap: 6px; padding: 0 15px; font-size: 11.5px; font-weight: 600; letter-spacing: .2em; text-transform: uppercase; color: #cfcbc5; text-decoration: none; white-space: nowrap; transition: color .25s; }
.nav__item > a::after { content: ""; position: absolute; left: 15px; right: 15px; bottom: 20px; height: 2px; background: var(--red); transform: scaleX(0); transform-origin: left; transition: transform .35s var(--ease); }
.nav__item > a i { font-style: normal; font-size: 9px; color: var(--mu); }
.nav__item:hover > a, .nav__item:focus-within > a, .nav__item.on > a { color: #fff; }
.nav__item:hover > a::after, .nav__item.on > a::after { transform: scaleX(1); }
.nav__sub { position: absolute; top: 100%; left: 0; min-width: 230px; background: rgba(14,14,14,.98); border: 1px solid var(--ln2); border-top: 2px solid var(--red); display: none; box-shadow: 0 24px 50px rgba(0,0,0,.5); }
.nav__item:hover .nav__sub, .nav__item:focus-within .nav__sub { display: block; }
.nav__sub a { display: block; padding: 15px 18px; font-size: 11.5px; font-weight: 600; letter-spacing: .18em; text-transform: uppercase; text-decoration: none; color: #cfcbc5; border-bottom: 1px solid var(--ln); transition: background .2s, color .2s, padding .25s var(--ease); }
.nav__sub a:last-child { border-bottom: 0; }
.nav__sub a:hover { background: var(--red); color: #fff; padding-left: 24px; }
.top__end { display: flex; align-items: stretch; margin-left: 8px; }
.nav__tel { display: flex; align-items: center; font-size: 13px; font-weight: 600; letter-spacing: .06em; text-decoration: none; white-space: nowrap; }
.nav__acc { display: flex; align-items: center; gap: 8px; padding: 0 18px; font-size: 11.5px; font-weight: 600; letter-spacing: .2em; text-transform: uppercase; text-decoration: none; color: #cfcbc5; transition: color .2s; }
.nav__acc svg { width: 17px; height: 17px; fill: none; stroke: currentColor; stroke-width: 1.8; }
.nav__acc:hover { color: #fff; }
.top__cta { display: flex; align-items: center; padding: 0 26px; background: var(--red); color: #fff; font-size: 11.5px; font-weight: 700; letter-spacing: .2em; text-transform: uppercase; text-decoration: none; white-space: nowrap; transition: background .25s; }
.top__cta:hover { background: #e01438; color: #fff; }
.burger { display: none; width: 72px; border: 0; border-left: 1px solid var(--ln); background: none; cursor: pointer; flex-direction: column; justify-content: center; align-items: center; gap: 7px; }
.burger span { display: block; width: 24px; height: 2px; background: var(--wh); transition: transform .25s; }
.menu-open .burger span:first-child { transform: translateY(4.5px) rotate(45deg); }
.menu-open .burger span:last-child { transform: translateY(-4.5px) rotate(-45deg); }

/* ---------- pagini simple ---------- */
.page, .paper { max-width: 1180px; margin: 0 auto; padding: 64px var(--pad) 90px; }
.page.wide { max-width: 1320px; }
.page > h1, .page .btnrow > h1 { font-size: clamp(44px, 7vw, 104px); margin: 0 0 18px; line-height: 1.1; }
.page h2 { font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(24px, 2.6vw, 34px); letter-spacing: .01em; line-height: 1; margin: 46px 0 14px; }
.page h3 { font-size: 18px; margin: 28px 0 10px; }
.page p, .page li { color: var(--wh2); }
.page ul, .page ol { padding-left: 20px; }
.lead { font-size: clamp(17px, 1.6vw, 20px); line-height: 1.65; color: var(--wh2) !important; max-width: 760px; margin: 0 0 30px; }
.page .ref { display: inline-block; font-family: var(--display); font-size: 30px; letter-spacing: .04em; color: #fff; border-bottom: 3px solid var(--red); padding: 0 2px 2px; }
.small { font-size: 14px; color: var(--wh2); }
.small p { margin: 0 0 9px; }
.muted { color: var(--mu) !important; }
.closed { padding: 40px 0; }
.closed h1 { font-size: clamp(38px, 5.5vw, 80px); margin-bottom: 18px; }
.stack > * + * { margin-top: 14px; }
.btnrow { display: flex; flex-wrap: wrap; gap: 14px; align-items: center; margin-top: 18px; }
.toolbar { display: flex; flex-wrap: wrap; gap: 12px; align-items: center; margin: 18px 0; }
.toolbar > select { flex: 1 1 240px; }
.toolbar .count { color: var(--mu); font-size: 14px; }

.box { border: 1px solid var(--ln); background: var(--bk2); padding: 28px 30px; margin: 0 0 -1px; }
.box h2 { margin-top: 0; }
.box + .box { margin-top: 0; }

.flash { padding: 14px 18px; margin: 0 0 18px; border: 1px solid var(--ln); border-left: 3px solid var(--ok); background: var(--bk2); color: var(--wh); font-size: 15px; }
.flash-err { border-left-color: var(--red); }
.alert { margin: 20px 0 0; padding: 16px 18px; border: 1px solid var(--red); border-left-width: 4px; background: rgba(200,16,46,.1); font-weight: 600; color: #fff; }
.badge-ok, .badge-bad { display: inline-flex; align-items: center; gap: 8px; padding: 8px 14px; font-size: 11.5px; font-weight: 700; letter-spacing: .18em; text-transform: uppercase; border: 1px solid; }
.badge-ok { color: var(--ok); border-color: rgba(127,209,138,.45); }
.badge-ok::before { content: "●"; }
.badge-bad { color: var(--red-t); border-color: rgba(255,77,99,.5); }

.kv { width: 100%; border-collapse: collapse; border-top: 1px solid var(--ln); margin: 10px 0; }
.kv td { padding: 15px 4px; border-bottom: 1px solid var(--ln); vertical-align: top; }
.kv td:first-child { width: 36%; font-size: 11px; font-weight: 600; letter-spacing: .2em; text-transform: uppercase; color: var(--mu); padding-top: 18px; }
.tbl { width: 100%; border-collapse: collapse; font-size: 15px; }
.tbl th { text-align: left; font-size: 11px; font-weight: 600; letter-spacing: .2em; text-transform: uppercase; color: var(--mu); padding: 12px 8px; border-bottom: 1px solid var(--ln2); }
.tbl td { padding: 14px 8px; border-bottom: 1px solid var(--ln); vertical-align: top; color: var(--wh2); }
.agenda li { margin: 6px 0; }
.votes { display: flex; flex-wrap: wrap; gap: 0; margin-top: 12px; }
.votes .btn { margin-right: -1px; }
.votes .btn.on { background: var(--red); border-color: var(--red); color: #fff; }
.code-in { font-family: var(--display) !important; font-size: 34px !important; letter-spacing: .3em; text-align: center; max-width: 280px; }

/* ---------- butoane ---------- */
.btn, a.btn { appearance: none; display: inline-flex; align-items: center; justify-content: center; gap: 9px; min-height: 52px; padding: 0 28px; border: 1px solid var(--wh); background: var(--wh); color: var(--bk); font: 700 12px/1 var(--text); letter-spacing: .2em; text-transform: uppercase; text-decoration: none; cursor: pointer; transition: background .2s, color .2s, border-color .2s; }
.btn:hover { background: var(--red); border-color: var(--red); color: #fff; }
.btn.red { background: var(--red); border-color: var(--red); color: #fff; }
.btn.red:hover { background: #fff; border-color: #fff; color: var(--bk); }
.btn.ghost { background: transparent; color: var(--wh); border-color: var(--ln2); }
.btn.ghost:hover { border-color: var(--wh); background: transparent; color: #fff; }
.btn:disabled { opacity: .5; cursor: wait; }

/* ---------- campuri ---------- */
.fl { display: block; margin: 0 0 16px; }
.fl > span, .lbl-q { display: block; font-size: 13.5px; font-weight: 500; color: var(--wh2); margin-bottom: 7px; line-height: 1.45; }
.lbl { display: block; margin-bottom: 8px; }
.fl i, .title i, .lbl i, .ck i { color: var(--red-t); font-style: normal; }
.lbl em, .small em, .fl em { color: var(--mu); font-style: normal; text-transform: none; letter-spacing: 0; }
input[type=text], input[type=email], input[type=tel], input[type=url], input[type=date], input[type=number], input[type=search], input:not([type]), textarea, select, input.other {
  width: 100%; font: 16px/1.4 var(--text); color: var(--wh); background: var(--bk2); border: 1px solid var(--ln2); border-radius: 0; padding: 13px 14px; outline: none; min-height: 50px; transition: border-color .2s, background .2s;
}
input::placeholder, textarea::placeholder { color: #6f6b66; }
input:focus, textarea:focus, select:focus { border-color: var(--red-t); background: var(--bk3); }
input[type=date] { color-scheme: dark; }
select { appearance: none; padding-right: 40px; cursor: pointer; background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='12' height='8' viewBox='0 0 12 8'%3E%3Cpath d='M1 1l5 5 5-5' stroke='%23f3f0eb' stroke-width='1.6' fill='none'/%3E%3C/svg%3E"); background-repeat: no-repeat; background-position: right 15px center; }
select option { background: var(--bk2); color: var(--wh); }
textarea { resize: vertical; line-height: 1.6; min-height: 120px; }
.fl.up input { text-transform: uppercase; }
.fl.is-bad input, .fl.is-bad textarea, .fl.is-bad select, .file.is-bad input { border-color: var(--red); background: rgba(200,16,46,.08); }
.err { display: block; color: var(--red-t); font-size: 13px; font-weight: 600; margin-top: 6px; }
.row2 { display: grid; grid-template-columns: 1fr 1fr; gap: 0 18px; }
.page form .fl { max-width: 560px; }
.page form .fl.full, .page .fl.full { max-width: none; }
.hp { position: absolute; left: -10000px; width: 1px; height: 1px; overflow: hidden; }

.checks { display: grid; gap: 2px 22px; margin: 6px 0 10px; }
.checks.cols-2 { grid-template-columns: 1fr 1fr; }
.checks.cols-3 { grid-template-columns: repeat(3, auto); justify-content: start; }
.ck { display: flex; align-items: flex-start; gap: 12px; cursor: pointer; font-size: 15px; line-height: 1.45; padding: 6px 0; color: var(--wh); }
.ck input { appearance: none; -webkit-appearance: none; flex: 0 0 auto; width: 20px; height: 20px; border: 1.5px solid var(--wh2); border-radius: 0; margin: 1px 0 0; background: transparent; display: grid; place-content: center; cursor: pointer; transition: border-color .15s, background .15s; }
.ck input[type=radio] { border-radius: 50%; }
.ck input::before { content: ""; width: 11px; height: 11px; transform: scale(0); transition: transform .12s ease; background: #fff; clip-path: polygon(14% 44%, 0 65%, 50% 100%, 100% 16%, 80% 0%, 43% 62%); }
.ck input[type=radio]::before { clip-path: none; border-radius: 50%; width: 8px; height: 8px; }
.ck input:checked { background: var(--red); border-color: var(--red); }
.ck input:checked::before { transform: scale(1); }
.ck:hover input { border-color: #fff; }
.ck.is-off { opacity: .4; cursor: not-allowed; }
.ck.strong { font-weight: 700; margin-top: 10px; }
input.other { margin: 2px 0 8px 32px; width: calc(100% - 32px); min-height: 44px; font-size: 15px; }
.checks.cols-2 input.other, .checks.cols-3 input.other { grid-column: 1 / -1; }

/* ---------- formularul de aderare ---------- */
.paper { max-width: 1320px; }
.title { border-bottom: 1px solid var(--ln); padding-bottom: 30px; margin-bottom: 8px; }
.title h1 { font-size: clamp(38px, 6vw, 90px); margin: 0; padding-top: .08em; line-height: 1.24; }
.title h2 { margin: 16px 0 10px; font-size: 12px; font-weight: 600; letter-spacing: .22em; text-transform: uppercase; color: var(--red-t); }
.title p { margin: 0; color: var(--wh2); font-size: 15px; }
.grid2 { display: grid; grid-template-columns: 1fr 1fr; gap: 0 48px; }
.grid2.flat { gap: 0 40px; }
.grid2.wide-left { grid-template-columns: 1.55fr 1fr; }
.sec { border-top: 1px solid var(--ln); padding: 30px 0 18px; margin-top: 0; }
.sec > h3 { margin: 0 0 20px; font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(24px, 2.4vw, 34px); letter-spacing: .01em; line-height: 1; color: #fff; display: flex; align-items: baseline; gap: 14px; }
.sec > h3::before { content: ""; width: 26px; height: 3px; background: var(--red); flex: 0 0 auto; transform: translateY(-6px); }
.sec .body { padding: 0; }
.sec.is-bad > h3 { color: var(--red-t); }
.cat .catrow { display: grid; grid-template-columns: 1fr 1fr 1.25fr; gap: 18px; align-items: stretch; }
.catopt { display: flex; gap: 14px; align-items: flex-start; cursor: pointer; padding: 20px; border: 1px solid var(--ln2); transition: border-color .2s, background .2s; }
.catopt:hover { border-color: var(--wh2); }
.catopt:has(input:checked) { border-color: var(--red); background: rgba(200,16,46,.08); }
.catopt input { appearance: none; -webkit-appearance: none; width: 22px; height: 22px; border: 1.5px solid var(--wh2); border-radius: 0; flex: 0 0 auto; margin: 2px 0 0; display: grid; place-content: center; }
.catopt input::before { content: ""; width: 12px; height: 12px; transform: scale(0); background: #fff; transition: transform .12s ease; }
.catopt input:checked { background: var(--red); border-color: var(--red); }
.catopt input:checked::before { transform: scale(1); }
.catopt strong { display: block; font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: 24px; letter-spacing: .01em; line-height: 1.05; }
.catopt small { color: var(--mu); font-size: 14px; }
.note, .tint { margin: 0; background: var(--bk2); border-left: 3px solid var(--red); padding: 14px 16px; font-size: 14px; color: var(--wh2); }
.tint { margin-top: 12px; }
.dues { display: grid; grid-template-columns: 1.1fr 1fr; gap: 20px; margin: 12px 0 14px; }
.dues__box { border: 1px solid var(--red); padding: 22px 18px; display: flex; flex-direction: column; gap: 4px; text-align: left; }
.dues__box span { font-size: 11px; font-weight: 600; letter-spacing: .2em; text-transform: uppercase; color: var(--mu); }
.dues__box strong { font-family: var(--display); font-weight: 400; color: #fff; font-size: clamp(38px, 4.4vw, 58px); line-height: 1; margin: 6px 0; }
.dues__box small { color: var(--mu); }
.dues__mode .lbl small { color: var(--mu); text-transform: none; letter-spacing: 0; }
.file { display: block; margin: 0 0 18px; }
.file > span { display: block; font-size: 13.5px; font-weight: 600; margin-bottom: 7px; }
.file > span em { font-weight: 400; color: var(--mu); }
.file input[type=file] { width: 100%; font-size: 14px; color: var(--wh2); padding: 14px; border: 1px dashed var(--ln2); background: var(--bk2); }
.file input[type=file]::file-selector-button { font: 700 11px var(--text); letter-spacing: .16em; text-transform: uppercase; border: 1px solid var(--wh); background: var(--wh); color: var(--bk); padding: 10px 14px; margin-right: 14px; cursor: pointer; }
.file small { display: block; color: var(--mu); font-size: 13px; margin-top: 6px; }
.signrow { display: grid; grid-template-columns: 1fr 1.5fr; gap: 28px; align-items: stretch; }
.signmeta p { margin: 0 0 18px; border-bottom: 1px solid var(--ln2); padding-bottom: 10px; }
.signmeta .lbl { margin-bottom: 4px; }
.signmeta strong { font-family: var(--display); font-weight: 400; font-size: 26px; letter-spacing: .02em; text-transform: uppercase; }
/* zona de semnat ramane alba, ca o foaie de hartie */
.pad { position: relative; border: 1px solid var(--wh2); background: #fff; min-height: 190px; }
.pad.has-ink { border-color: #fff; }
.pad canvas { display: block; width: 100%; height: 190px; touch-action: none; cursor: crosshair; }
.pad__hint { position: absolute; inset: 0; display: grid; place-items: center; color: #8a8580; pointer-events: none; font-size: 15px; }
.pad.has-ink .pad__hint { display: none; }
.pad__clear { position: absolute; right: 0; bottom: 0; background: var(--bk); color: #fff; border: 0; padding: 9px 14px; font: 700 10.5px var(--text); letter-spacing: .16em; text-transform: uppercase; cursor: pointer; }
.pad__clear:hover { background: var(--red); }
.sec.sign.is-bad .pad { border-color: var(--red); box-shadow: 0 0 0 2px var(--red); }
.steps { display: none; }
.nav-f, form > .nav { display: flex; justify-content: flex-end; gap: 0; margin-top: 30px; border-top: 1px solid var(--ln); padding-top: 26px; }
form > .nav .btn { margin-left: -1px; }

/* ---------- membri (lista) ---------- */
.mhero { padding: 64px var(--pad) 0; border-bottom: 1px solid var(--ln); overflow: hidden; }
.mhero .k-row { display: flex; justify-content: space-between; gap: 30px; align-items: flex-start; margin-bottom: 28px; }
.mhero .side { max-width: 380px; font-size: 15px; line-height: 1.7; color: var(--wh2); margin: 0; }
.mhero h1 { font-size: clamp(76px, 16.5vw, 280px); margin: 0; padding-bottom: .2em; line-height: .96; }
.mhero h1 span { display: block; }
.stats { display: grid; grid-template-columns: repeat(3, 1fr); border-top: 1px solid var(--ln); margin: 34px calc(-1 * var(--pad)) 0; }
.stats div { padding: 22px var(--pad); border-right: 1px solid var(--ln); }
.stats div:last-child { border-right: 0; }
.stats b { display: block; font-family: var(--display); font-weight: 400; font-size: 54px; line-height: 1; color: #fff; }
.stats b em { font-style: normal; color: var(--red); }
.filters { display: flex; align-items: stretch; border-bottom: 1px solid var(--ln); position: sticky; top: 72px; z-index: 20; background: var(--bk); }
.filters input[type=search] { flex: 1; min-width: 0; border: 0; border-right: 1px solid var(--ln); background: transparent; padding: 0 var(--pad); min-height: 66px; }
.filters select { width: auto; border: 0; border-right: 1px solid var(--ln); background-color: transparent; min-height: 66px; font-size: 11.5px; font-weight: 600; letter-spacing: .18em; text-transform: uppercase; padding: 0 44px 0 22px; }
.filters .cats { display: flex; }
.filters .cats button { border: 0; border-right: 1px solid var(--ln); background: none; color: var(--mu); padding: 0 20px; font: 600 11.5px var(--text); letter-spacing: .18em; text-transform: uppercase; cursor: pointer; }
.filters .cats button:hover { color: #fff; }
.filters .cats button.on { background: var(--red); color: #fff; }
.filters .n { display: flex; align-items: center; gap: 8px; padding: 0 var(--pad); font-size: 13px; color: var(--mu); white-space: nowrap; }
.filters .n b { font-family: var(--display); font-weight: 400; font-size: 24px; color: #fff; }
.tiles { display: grid; grid-template-columns: repeat(4, 1fr); border-bottom: 1px solid var(--ln); }
.tile { position: relative; aspect-ratio: 3/4; overflow: hidden; display: block; text-decoration: none; background: var(--bk); border-right: 1px solid var(--ln); border-bottom: 1px solid var(--ln); margin-bottom: -1px; }
.tile[hidden] { display: none; }
.tile img.cv { position: absolute; inset: 0; width: 100%; height: 100%; object-fit: cover; filter: grayscale(1) contrast(1.05) brightness(.8); transform: scale(1.02); transition: filter .6s, transform 1.2s cubic-bezier(.2,.7,.2,1); }
.tile:hover img.cv, .tile:focus-visible img.cv { filter: none; transform: scale(1.07); }
.tile::after { content: ""; position: absolute; inset: 0; background: linear-gradient(180deg, rgba(10,10,10,.5) 0%, rgba(10,10,10,0) 28%, rgba(10,10,10,0) 48%, rgba(10,10,10,.94) 100%); pointer-events: none; }
.tile .num { position: absolute; z-index: 2; top: 20px; left: 22px; font-size: 11px; font-weight: 700; letter-spacing: .24em; color: #fff; }
.tile .num i { font-style: normal; color: var(--red-t); }
.tile .ghost { position: absolute; z-index: 1; left: -6px; right: -10px; bottom: 36%; font-family: var(--display); font-size: clamp(100px, 11.5vw, 190px); line-height: .8; color: transparent; -webkit-text-stroke: 1px #2c2c2c; transition: -webkit-text-stroke-color .4s, transform 1s; white-space: nowrap; }
.tile:hover .ghost { -webkit-text-stroke-color: var(--red); transform: translateX(10px); }
.tile .who { position: absolute; z-index: 2; left: 22px; right: 22px; bottom: 22px; }
.tile .who h3 { margin: 0; font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(24px, 2.2vw, 34px); line-height: .98; color: #fff; }
.tile .who p { margin: 8px 0 0; font-size: 13px; color: #c8c5c0; }
.tile .cat { display: inline-block; margin-top: 12px; font-size: 10.5px; font-weight: 700; letter-spacing: .22em; text-transform: uppercase; color: var(--red-t); }
.tile .bar { position: absolute; z-index: 2; left: 0; bottom: 0; height: 3px; width: 0; background: var(--red); transition: width .5s cubic-bezier(.2,.7,.2,1); }
.tile:hover .bar, .tile:focus-visible .bar { width: 100%; }
.tile .go { position: absolute; z-index: 2; right: 20px; top: 15px; font-size: 22px; color: #fff; opacity: 0; transform: translate(-6px, 6px); transition: .35s; }
.tile:hover .go { opacity: 1; transform: none; }
.tile .badge { position: absolute; z-index: 3; top: 15px; right: 16px; padding: 6px 10px 5px; background: var(--red); color: #fff; font-size: 10px; font-weight: 700; letter-spacing: .2em; text-transform: uppercase; line-height: 1; }
.tile--f { box-shadow: inset 0 3px 0 var(--red); }
.tile--f .cat { color: #fff; }
.tile--f .go { display: none; }
.empty-list { padding: 70px var(--pad); color: var(--mu); }
.list-note { padding: 26px var(--pad) 40px; font-size: 14px; color: var(--mu); }

/* ---------- membri (profil) ---------- */
.pbar { position: sticky; top: 72px; z-index: 20; height: 60px; display: flex; align-items: stretch; border-bottom: 1px solid var(--ln); background: rgba(10,10,10,.94); backdrop-filter: blur(10px); }
.pbar > * { display: flex; align-items: center; gap: 8px; padding: 0 24px; border-right: 1px solid var(--ln); font-size: 11.5px; font-weight: 600; letter-spacing: .2em; text-transform: uppercase; text-decoration: none; background: none; border-top: 0; border-bottom: 0; border-left: 0; color: var(--wh); cursor: pointer; font-family: var(--text); }
.pbar a:hover, .pbar button:hover { background: var(--bk3); color: #fff; }
.pbar .mid { flex: 1; justify-content: center; color: var(--mu); cursor: default; }
.pbar .mid b { color: #fff; font-family: var(--display); font-weight: 400; font-size: 20px; letter-spacing: .04em; }
.pbar > :last-child { border-right: 0; }
.band { position: relative; height: min(64vh, 620px); min-height: 380px; overflow: hidden; border-bottom: 1px solid var(--ln); background: #000; }
.track { position: absolute; top: 0; bottom: 0; left: 0; display: flex; animation: roll var(--dur, 90s) linear infinite; will-change: transform; }
.band.paused .track { animation-play-state: paused; }
.track img { height: 100%; width: auto; display: block; }
@keyframes roll { to { transform: translateX(calc(-1 * var(--loop, 50%))); } }
.band::after { content: ""; position: absolute; inset: 0; pointer-events: none; background: linear-gradient(180deg, rgba(10,10,10,0) 38%, rgba(10,10,10,.95) 100%); }
.track button { height: 100%; flex: 0 0 auto; padding: 0; border: 0; background: #000; cursor: zoom-in; }
.track img { opacity: 0; transition: opacity .8s; }
.band.ready .track img { opacity: 1; }
/* profil fara lucrari: antet compact, cu lumina rosie discreta (nu un bloc negru gol) */
.band.empty { height: 360px; min-height: 0; background: radial-gradient(60% 120% at 88% 110%, rgba(200,16,46,.32), transparent 62%), radial-gradient(40% 80% at 10% -20%, rgba(255,255,255,.05), transparent 70%), linear-gradient(180deg, #131313, #0a0a0a); }
.band.empty::before { content: ""; position: absolute; inset: 0; background-image: repeating-linear-gradient(115deg, rgba(255,255,255,.025) 0 1px, transparent 1px 26px); pointer-events: none; }
.band .ghostnum { position: absolute; right: -20px; bottom: -50px; font-family: var(--display); font-size: clamp(260px, 34vw, 480px); line-height: .8; color: transparent; -webkit-text-stroke: 1px rgba(255,255,255,.11); }
/* lucrarea marita */
.lb { position: fixed; inset: 0; z-index: 95; display: grid; place-items: center; padding: 60px 80px; background: rgba(6,6,6,.96); }
.lb[hidden] { display: none; }
.lb img { max-width: 100%; max-height: calc(100vh - 120px); object-fit: contain; box-shadow: 0 40px 90px rgba(0,0,0,.7); }
.lb__x { position: absolute; top: 18px; right: 18px; width: 48px; height: 48px; border: 1px solid var(--ln2); background: none; color: #fff; font-size: 18px; cursor: pointer; }
.lb__nav { position: absolute; top: 50%; transform: translateY(-50%); width: 54px; height: 54px; border: 1px solid var(--ln2); background: rgba(10,10,10,.6); color: #fff; font-size: 22px; cursor: pointer; transition: background .2s, border-color .2s; }
.lb__prev { left: 18px; } .lb__next { right: 18px; }
.lb__x:hover, .lb__nav:hover { background: var(--red); border-color: var(--red); }
.lb__n { position: absolute; bottom: 20px; left: 50%; transform: translateX(-50%); font-size: 12px; font-weight: 700; letter-spacing: .2em; color: var(--mu); }
.ident { position: absolute; z-index: 3; left: 0; right: 0; bottom: 0; padding: 0 var(--pad) 34px; display: grid; grid-template-columns: auto 1fr auto; gap: 26px; align-items: end; }
.ident .av { width: 84px; height: 84px; border-radius: 50%; object-fit: cover; display: grid; place-items: center; background: #1a1a1a; font-family: var(--display); font-size: 30px; box-shadow: 0 0 0 3px var(--bk), 0 0 0 5px var(--red); }
.ident h1 { font-size: clamp(46px, 8.4vw, 150px); line-height: .98; padding-top: .08em; margin: 0; }
.ident .sub { margin-top: 14px; display: flex; gap: 22px; flex-wrap: wrap; font-size: 12px; font-weight: 600; letter-spacing: .2em; text-transform: uppercase; color: #c8c5c0; }
.ident .sub .r { color: var(--red-t); }
.ident .no { text-align: right; }
.ident .no .d { font-size: clamp(64px, 9vw, 150px); display: block; }
.spec { display: grid; grid-template-columns: repeat(4, 1fr); border-bottom: 1px solid var(--ln); }
.spec > div { padding: 22px var(--pad); border-right: 1px solid var(--ln); }
.spec > div:last-child { border-right: 0; }
.spec .v { margin-top: 8px; font-size: 17px; font-weight: 600; color: #fff; }
.spec .v.ok { color: var(--ok); }
.pmain { display: grid; grid-template-columns: 1.5fr 1fr; border-bottom: 1px solid var(--ln); }
.pmain > div { padding: 44px var(--pad) 50px; }
.pmain > div + div { border-left: 1px solid var(--ln); }
.about { font-size: clamp(19px, 1.8vw, 25px); line-height: 1.5; font-weight: 500; color: #e9e6e1; margin: 18px 0 0; max-width: 760px; }
.about.empty { color: #77736e; font-size: 17px; }
.about + .about { margin-top: 16px; }
.tags { display: flex; flex-wrap: wrap; gap: 8px; margin-top: 26px; }
.tags span { padding: 8px 14px; border: 1px solid var(--ln2); font-size: 11.5px; font-weight: 700; letter-spacing: .16em; text-transform: uppercase; color: var(--wh); }
.tags span:first-child { border-color: var(--red); color: #fff; background: rgba(200,16,46,.12); }
.styles-pick { grid-template-columns: repeat(3, minmax(0, 1fr)) !important; }
.styles-pick .ck input:disabled + span { opacity: .4; }
.count { display: block; margin-top: 6px; font-size: 12.5px; color: var(--mu); }
.links { margin-top: 16px; border-top: 1px solid var(--ln); }
.links a, .links button { position: relative; display: flex; align-items: center; justify-content: space-between; gap: 14px; width: 100%; padding: 20px 0; border: 0; border-bottom: 1px solid var(--ln); background: none; color: var(--wh); overflow: hidden; text-align: left; text-decoration: none; font: inherit; cursor: pointer; }
.links .k { width: 110px; flex: 0 0 auto; position: relative; z-index: 1; transition: color .3s; }
.links .v { flex: 1; font-size: 17px; font-weight: 600; position: relative; z-index: 1; overflow-wrap: anywhere; }
.links .ar { font-size: 20px; position: relative; z-index: 1; transition: transform .3s; }
.links a::before, .links button::before { content: ""; position: absolute; inset: 0 calc(-1 * var(--pad)); background: var(--red); transform: scaleY(0); transform-origin: bottom; transition: transform .35s cubic-bezier(.2,.7,.2,1); }
.links a:hover::before, .links button:hover::before { transform: scaleY(1); }
.links a:hover .k, .links button:hover .k { color: #fff; }
.links a:hover .ar, .links button:hover .ar { transform: translateX(6px); }
.verify-band { display: flex; align-items: center; justify-content: space-between; gap: 20px; padding: 30px var(--pad); border-bottom: 1px solid var(--ln); background: linear-gradient(90deg, rgba(200,16,46,.16), transparent 60%); }
.verify-band .t { font-family: var(--display); font-size: clamp(24px, 2.8vw, 42px); text-transform: uppercase; line-height: 1; }
.rel h2 { font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(34px, 4vw, 60px); line-height: 1; margin: 0; padding: 46px var(--pad) 22px; border-bottom: 1px solid var(--ln); }
.toast { position: fixed; left: 50%; bottom: 26px; max-width: calc(100vw - 32px); text-align: center; transform: translate(-50%, 16px); background: var(--red); color: #fff; padding: 12px 20px; font-size: 13px; font-weight: 600; letter-spacing: .06em; opacity: 0; transition: .3s; z-index: 90; pointer-events: none; }
.toast.on { opacity: 1; transform: translate(-50%, 0); }

/* ---------- contul de membru ---------- */
.works { display: grid; grid-template-columns: repeat(auto-fill, minmax(160px, 1fr)); gap: 10px; margin: 16px 0 6px; }
.work { position: relative; margin: 0; background: var(--bk3); border: 1px solid var(--ln2); }
.work img { display: block; width: 100%; height: 160px; object-fit: cover; }
.work--pending img { opacity: .55; }
.work--pending { border-color: #b27a1c; }
.work__gone { display: grid; place-items: center; height: 160px; padding: 10px; text-align: center; font-size: 12px; color: var(--mu); }
.work figcaption { display: flex; flex-wrap: wrap; align-items: center; justify-content: space-between; gap: 6px 8px; padding: 8px; }
.work figcaption .work__st { flex: 1 1 100%; }
.work__st { font-size: 10.5px; font-weight: 700; letter-spacing: .14em; text-transform: uppercase; color: var(--mu); }
.work--approved .work__st { color: var(--ok); } .work--pending .work__st { color: #f0a24a; }
.work form { display: flex; gap: 2px; }
.work button { width: 26px; height: 26px; border: 1px solid var(--ln2); background: none; color: var(--wh); cursor: pointer; font-size: 12px; }
.work button:hover { background: var(--red); border-color: var(--red); }
.photo-box { display: flex; gap: 20px; align-items: center; flex-wrap: wrap; }
.photo-box img, .photo-box .ini { width: 96px; height: 96px; border-radius: 50%; object-fit: cover; box-shadow: 0 0 0 3px var(--bk2), 0 0 0 5px var(--red); }
.photo-box .ini { display: grid; place-items: center; background: #1a1a1a; font-family: var(--display); font-size: 32px; color: #fff; }

/* ---------- banda rosie, valorile, subsolul ---------- */
.ticker { background: var(--red); color: #fff; overflow: hidden; white-space: nowrap; }
.ticker div { display: inline-flex; animation: tk 40s linear infinite; }
.ticker span { font-family: var(--display); font-size: 22px; letter-spacing: .06em; text-transform: uppercase; padding: 13px 0; }
.ticker span::after { content: "✦"; font-family: var(--text); font-size: 12px; margin: 0 26px; vertical-align: 3px; opacity: .85; }
@keyframes tk { to { transform: translateX(-50%); } }
.pillars { display: grid; grid-template-columns: repeat(4, 1fr); border-bottom: 1px solid var(--ln); }
.pillar { padding: 34px var(--pad); border-right: 1px solid var(--ln); display: flex; flex-direction: column; gap: 6px; }
.pillar:last-child { border-right: 0; }
.pillar svg { width: 34px; height: 34px; fill: none; stroke: var(--red-t); stroke-width: 1.5; stroke-linejoin: round; stroke-linecap: round; margin-bottom: 10px; }
.pillar strong { font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: 26px; letter-spacing: .02em; line-height: 1; color: #fff; }
.pillar span { font-size: 14px; color: var(--mu); }
.foot { font-size: 14px; color: var(--mu); }
.foot__grid { display: grid; grid-template-columns: 1.4fr 1fr 1fr 1fr; border-bottom: 1px solid var(--ln); }
.foot__grid > div { padding: 40px var(--pad); border-right: 1px solid var(--ln); display: flex; flex-direction: column; gap: 11px; }
.foot__grid > div:last-child { border-right: 0; }
.foot__brand img { height: 52px; width: auto; align-self: flex-start; margin-bottom: 8px; }
.foot__brand p { margin: 0; color: var(--wh2); }
.foot__brand p.m { color: var(--mu); font-size: 13.5px; }
.foot__h { font-size: 11px; font-weight: 600; letter-spacing: .22em; text-transform: uppercase; color: #fff; margin-bottom: 6px; }
.foot a { color: var(--mu); text-decoration: none; }
.foot a:hover { color: #fff; }
.foot__bar { display: flex; justify-content: space-between; gap: 20px; flex-wrap: wrap; padding: 22px var(--pad); font-size: 12.5px; }

/* ---------- site: piese comune ---------- */
.foot__soc { display: flex; flex-wrap: wrap; gap: 8px 18px; margin-top: 6px; }
.foot__soc a { font-size: 11px; font-weight: 600; letter-spacing: .18em; text-transform: uppercase; }
.btn i { font-style: normal; transition: transform .3s var(--ease); }
.btn:hover i { transform: translateX(5px); }
.btn.ghost { border-color: rgba(255,255,255,.3); }
.btn.dark { background: var(--bk); border-color: var(--bk); color: #fff; }
.btn.dark:hover { background: #fff; border-color: #fff; color: var(--bk); }
.sec-h { display: flex; justify-content: space-between; align-items: flex-end; gap: 30px; padding: 0 var(--pad) 30px; }
.sec-h h2 { margin: 0; font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(46px, 6vw, 96px); line-height: 1; }
.sec-h__all { display: inline-flex; gap: 10px; font-size: 12px; font-weight: 700; letter-spacing: .2em; text-transform: uppercase; text-decoration: none; padding-bottom: 6px; border-bottom: 2px solid var(--red); white-space: nowrap; }
.sec-h__all span { transition: transform .3s var(--ease); }
.sec-h__all:hover span { transform: translateX(5px); }

/* cardul unui articol */
.card { position: relative; display: flex; flex-direction: column; background: var(--bk2); overflow: hidden; text-decoration: none; color: var(--wh); transition: background .4s; }
.card:hover { background: var(--bk3); color: var(--wh); }
.cv { position: relative; overflow: hidden; aspect-ratio: 16 / 10; background: var(--bk3); }
.cv img { width: 100%; height: 100%; object-fit: cover; display: block; transition: transform 1.2s var(--ease); }
.card:hover .cv img { transform: scale(1.06); }
.cv--gen { display: flex; flex-direction: column; justify-content: space-between; padding: 22px 24px; background: radial-gradient(120% 90% at 100% 0%, rgba(200,16,46,.5), transparent 55%), linear-gradient(135deg, #1a1a1a, #0d0d0d); }
.cv--gen::after { content: ""; position: absolute; right: -50px; bottom: -50px; width: 220px; height: 220px; border: 1px solid rgba(255,255,255,.07); border-radius: 50%; box-shadow: 0 0 0 30px rgba(255,255,255,.018), 0 0 0 60px rgba(255,255,255,.012); }
.cv--g1 { background: radial-gradient(110% 80% at 0% 100%, rgba(200,16,46,.45), transparent 55%), linear-gradient(200deg, #1b1b1b, #0c0c0c); }
.cv--g2 { background: radial-gradient(90% 70% at 50% 120%, rgba(200,16,46,.5), transparent 60%), linear-gradient(160deg, #161616, #0b0b0b); }
.cv--g1::after { right: auto; left: -60px; bottom: auto; top: -60px; }
.cv__mo { position: relative; z-index: 1; font-size: 11px; font-weight: 700; letter-spacing: .24em; text-transform: uppercase; color: #fff; }
.cv__day { position: relative; z-index: 1; font-family: var(--display); font-size: clamp(70px, 8vw, 120px); line-height: .8; color: transparent; -webkit-text-stroke: 1.5px rgba(255,255,255,.55); transition: -webkit-text-stroke-color .4s, transform .8s var(--ease); }
.card:hover .cv__day { -webkit-text-stroke-color: var(--red-t); transform: translateX(8px); }
.card__body { padding: 24px 26px 28px; display: flex; flex-direction: column; flex: 1; }
.card .meta { display: flex; flex-wrap: wrap; gap: 6px 14px; align-items: center; font-size: 10.5px; font-weight: 700; letter-spacing: .2em; text-transform: uppercase; color: var(--mu); }
.card .meta b { color: var(--red-t); font-weight: 700; }
.card h3 { margin: 12px 0 0; font-size: 19px; line-height: 1.32; font-weight: 600; color: #fff; }
.card p { margin: 12px 0 0; color: var(--mu); font-size: 14.5px; line-height: 1.6; }
.card__bar { position: absolute; left: 0; bottom: 0; height: 3px; width: 100%; background: var(--red); transform: scaleX(0); transform-origin: left; transition: transform .6s var(--ease); }
.card:hover .card__bar { transform: scaleX(1); }
.card.big h3 { font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(26px, 2.6vw, 40px); line-height: 1.2; }
.card.big .card__body { padding: 28px 32px 34px; }
.card--row { flex-direction: row; }
.card--row .cv { flex: 0 0 42%; aspect-ratio: auto; }
.card--row .cv__day { font-size: 64px; }
.card--row .cv--gen { padding: 16px 18px; }
.card--row .card__body { justify-content: center; padding: 18px 22px; }
.card--row h3 { font-size: 16.5px; margin-top: 8px; }

/* antetul unei pagini */
.p-head { position: relative; overflow: hidden; border-bottom: 1px solid var(--ln); isolation: isolate; }
.p-head__bg { position: absolute; inset: -4%; z-index: -2; background: var(--bk) var(--bg) center / cover no-repeat; filter: grayscale(.35) brightness(.42); transform: scale(1.04); animation: ph-drift 26s ease-in-out infinite alternate; }
.p-head::before { content: ""; position: absolute; inset: 0; z-index: -1; background: radial-gradient(70% 90% at 90% 0%, rgba(200,16,46,.3), transparent 60%), linear-gradient(90deg, rgba(10,10,10,.95), rgba(10,10,10,.7) 60%, rgba(10,10,10,.55)), linear-gradient(0deg, var(--bk), transparent 50%); }
.p-head.has-cover .p-head__bg { filter: brightness(.55); }
@keyframes ph-drift { to { transform: scale(1.12) translate(-1.5%, -1%); } }
.p-head__in { max-width: 1240px; margin: 0 auto; padding: clamp(56px, 8vw, 110px) var(--pad) clamp(40px, 5vw, 64px); }
.p-head h1 { margin: 0; font-size: clamp(42px, 6.6vw, 104px); line-height: 1.16; padding-top: .06em; max-width: 1100px; overflow-wrap: anywhere; animation: ph-in 1s var(--ease) both; }
@keyframes ph-in { from { opacity: 0; transform: translateY(24px); } }
.p-sub { margin: 18px 0 0; font-size: 15px; color: var(--wh2); }
.crumb { display: flex; flex-wrap: wrap; gap: 0 10px; margin-bottom: 26px; font-size: 11px; font-weight: 600; letter-spacing: .2em; text-transform: uppercase; color: var(--mu); }
.crumb a, .crumb span { color: var(--mu); text-decoration: none; }
.crumb > * + *::before { content: "/"; margin-right: 10px; color: var(--ln2); }
.crumb a:hover { color: #fff; }
.p-kick { display: flex; flex-wrap: wrap; align-items: center; gap: 8px 18px; margin-bottom: 18px; font-size: 11.5px; font-weight: 700; letter-spacing: .2em; text-transform: uppercase; color: var(--wh2); }
.p-kick a { color: var(--red-t); text-decoration: none; }
.p-kick > * + *::before { content: ""; display: inline-block; width: 4px; height: 4px; margin-right: 18px; vertical-align: middle; background: var(--red); border-radius: 50%; }

/* textul paginilor si al articolelor */
.prose { max-width: 1240px; margin: 0 auto; padding: clamp(48px, 6vw, 80px) var(--pad) 80px; font-size: 18px; line-height: 1.8; color: #ddd8d0; overflow-wrap: break-word; }
.prose > :first-child { margin-top: 0; }
.prose p, .prose ul, .prose ol, .prose div { max-width: 760px; }
.prose p { margin: 0 0 18px; }
.prose div:not(:has(div, p, h2, h3, h4, ul, ol, table, blockquote)) { margin: 0 0 16px; }
.prose div:empty { display: none; }
.prose--page > p:first-of-type, .a-body > p:first-of-type { font-size: clamp(19px, 1.7vw, 22px); line-height: 1.7; color: #f0ece6; }
.prose h2, .prose h3, .prose h4 { max-width: 760px; color: #fff; line-height: 1.22; margin: 52px 0 16px; }
.prose h2 { font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(28px, 3vw, 42px); letter-spacing: .01em; line-height: 1.08; }
.prose h2::before { content: ""; display: block; width: 44px; height: 3px; background: var(--red); margin-bottom: 18px; }
.prose h2 + h2 { margin-top: -6px; font-family: var(--text); font-weight: 600; text-transform: none; font-size: clamp(20px, 2vw, 24px); line-height: 1.35; color: var(--wh2); letter-spacing: 0; }
.prose h2 + h2::before { display: none; }
.prose h2:empty, .prose h3:empty { display: none; }
.prose h3 { font-size: 22px; }
.prose h4 { font-size: 18px; }
.prose strong, .prose b { color: #fff; }
.prose a { color: #fff; text-decoration-color: var(--red); text-decoration-thickness: 2px; text-underline-offset: 4px; transition: color .2s; }
.prose a:hover { color: var(--red-t); }
.prose ul, .prose ol { padding-left: 24px; margin: 0 0 20px; }
.prose li { margin: 0 0 8px; }
.prose li::marker { color: var(--red-t); }
.prose img { display: block; height: auto; max-width: min(100%, 980px); margin: 34px 0; box-shadow: 0 30px 70px -30px rgba(0,0,0,.9); }
.prose iframe { display: block; width: 100%; max-width: 980px; height: auto; aspect-ratio: 16 / 9; border: 0; margin: 34px 0; background: #000; }
.prose blockquote { max-width: 760px; margin: 36px 0; padding: 4px 0 4px 28px; border-left: 3px solid var(--red); font-size: 20px; line-height: 1.6; color: #fff; }
.prose table { border-collapse: collapse; margin: 26px 0; max-width: 100%; display: block; overflow-x: auto; }
.prose td, .prose th { border: 1px solid var(--ln2); padding: 10px 14px; }
.prose hr { border: 0; border-top: 1px solid var(--ln2); margin: 40px 0; max-width: 760px; }
.prose a[href$=".pdf"], .prose a[href$=".doc"], .prose a[href$=".docx"], .prose a[href$=".xls"], .prose a[href$=".xlsx"] { display: inline-flex; gap: 12px; align-items: center; max-width: 760px; padding: 18px 22px; border: 1px solid var(--ln2); background: var(--bk2); text-decoration: none; line-height: 1.45; transition: border-color .2s, background .2s; }
.prose a[href$=".pdf"]::before, .prose a[href$=".doc"]::before, .prose a[href$=".docx"]::before, .prose a[href$=".xls"]::before, .prose a[href$=".xlsx"]::before { content: "↓"; flex: 0 0 auto; width: 34px; height: 34px; display: grid; place-items: center; background: var(--red); color: #fff; font-weight: 700; }
.prose a[href$=".pdf"]:hover, .prose a[href$=".doc"]:hover, .prose a[href$=".docx"]:hover { border-color: var(--red); background: var(--bk3); color: #fff; }
.prose--flat { padding: 0; }
.nf-btns { display: flex; gap: 12px; flex-wrap: wrap; }

/* ---------- editorul pe sectiuni (articole si pagini) ----------
   Formatarile din text (font, marime, grosime, aliniere) si blocurile: sectiuni cu fundal,
   coloane, imagini, galerii, butoane, citate. O sectiune obisnuita nu are invelis (HTML clasic). */
.prose .ql-font-inter { font-family: var(--text); }
.prose .ql-font-anton { font-family: var(--display); font-weight: 400; letter-spacing: .01em; font-synthesis: none; }
.prose .ql-font-playfair { font-family: 'Playfair Display', Georgia, serif; }
.prose .ql-font-georgia { font-family: Georgia, 'Times New Roman', serif; }
.prose .ql-size-s { font-size: .85em; }
.prose .ql-size-l { font-size: 1.3em; line-height: 1.5; }
.prose .ql-size-xl { font-size: 1.75em; line-height: 1.3; }
.prose .ql-size-xxl { font-size: 2.6em; line-height: 1.12; }
.prose .fw-400 { font-weight: 400; } .prose .fw-500 { font-weight: 500; } .prose .fw-600 { font-weight: 600; }
.prose .fw-700 { font-weight: 700; } .prose .fw-800 { font-weight: 800; } .prose .fw-900 { font-weight: 900; }
.prose .ql-align-center { text-align: center; } .prose .ql-align-right { text-align: right; }
.prose .ql-align-justify { text-align: justify; hyphens: auto; -webkit-hyphens: auto; }
.prose span[style] strong, .prose strong[style] { color: inherit; }
/* titluri */
.prose h2.b-hs-s { font-size: clamp(22px, 2.2vw, 28px); }
.prose h2.b-hs-l { font-size: clamp(36px, 4.4vw, 60px); line-height: 1.06; }
.prose h2.b-hs-xl { font-size: clamp(44px, 6.4vw, 92px); line-height: 1.02; }
.prose h3.b-hs-s { font-size: 18px; } .prose h3.b-hs-l { font-size: clamp(24px, 2.4vw, 30px); } .prose h3.b-hs-xl { font-size: clamp(28px, 3.2vw, 40px); }
.prose .b-noup { text-transform: none; letter-spacing: 0; }
.prose h2.b-nobar::before { display: none; }
.prose h2.ql-align-center::before { margin-left: auto; margin-right: auto; }
.prose h2.ql-align-right::before { margin-left: auto; }
/* sectiuni si coloane */
.prose .b-sec { position: relative; max-width: none; margin: 48px 0; }
.prose .b-sec.b-pad-s { margin: 24px 0; } .prose .b-sec.b-pad-l { margin: 88px 0; }
.prose > .b-sec:first-child { margin-top: 0; }
.prose div.b-row { display: grid; gap: clamp(24px, 4vw, 56px); align-items: start; margin: 0; max-width: none; }
.prose .b-w-normal > div.b-row { max-width: 760px; }
.prose .b-l-1 { grid-template-columns: minmax(0, 1fr); }
.prose .b-l-1-1 { grid-template-columns: repeat(2, minmax(0, 1fr)); }
.prose .b-l-1-1-1 { grid-template-columns: repeat(3, minmax(0, 1fr)); }
.prose .b-l-2-1 { grid-template-columns: minmax(0, 2fr) minmax(0, 1fr); }
.prose .b-l-1-2 { grid-template-columns: minmax(0, 1fr) minmax(0, 2fr); }
.prose div.b-col { display: block; margin: 0; max-width: none; min-width: 0; }
.prose .b-col > * { max-width: none; }
.prose .b-col > :first-child, .prose .b-col > :first-child.b-img img { margin-top: 0; }
.prose .b-col > :last-child { margin-bottom: 0; }
/* fundal: sectiunea se intinde pe toata latimea ecranului, textul ramane aliniat cu pagina */
.prose .b-sec:not(.b-bg-none) { margin: 0 calc(50% - 50vw); padding: clamp(56px, 7vw, 96px) max(var(--pad), calc(50vw - 620px + var(--pad))); }
.prose .b-sec.b-pad-s:not(.b-bg-none) { padding-top: 36px; padding-bottom: 36px; }
.prose .b-sec.b-pad-l:not(.b-bg-none) { padding-top: clamp(80px, 10vw, 140px); padding-bottom: clamp(80px, 10vw, 140px); }
.prose .b-sec:not(.b-bg-none) + .b-sec:not(.b-bg-none) { margin-top: 0; }
.prose .b-sec:not(.b-bg-none):last-child { margin-bottom: 0; }
.b-bg-dark { background: var(--bk3); border-top: 1px solid var(--ln); border-bottom: 1px solid var(--ln); }
.b-bg-red { background: var(--red); color: #fff; }
.prose .b-bg-red h2::before { background: #fff; }
.prose .b-bg-red a, .prose .b-bg-red li::marker, .prose .b-bg-red strong { color: #fff; text-decoration-color: #fff; }
.prose .b-bg-red blockquote { border-left-color: #fff; }
.b-bg-light { background: var(--wh); color: #2a2826; }
.prose .b-bg-light h2, .prose .b-bg-light h3, .prose .b-bg-light h4, .prose .b-bg-light strong, .prose .b-bg-light b, .prose .b-bg-light blockquote { color: #0a0a0a; }
.prose .b-bg-light a { color: #0a0a0a; } .prose .b-bg-light a:hover { color: var(--red); }
.prose .b-bg-light hr { border-top-color: #d6d2cc; }
.prose .b-bg-light .btn.ghost { color: #0a0a0a; border-color: #0a0a0a; }
.b-bg-image { background: #000 center / cover no-repeat; color: #fff; }
.b-bg-image::before { content: ""; position: absolute; inset: 0; background: rgba(0,0,0, var(--dim, .5)); pointer-events: none; }
.b-bg-image > .b-row { position: relative; }
/* fundal pe strat separat (blur, fix, parallax); textul nu e atins */
.b-bg-image:has(> .b-bgl) { background: #000; isolation: isolate; overflow: hidden; overflow: clip; }
.b-bg-image:has(> .b-bgl)::before { background: var(--ovl, rgba(0,0,0,.5)); }
.prose div.b-bgl { display: block; max-width: none; margin: 0; }
.b-bgl { position: absolute; z-index: -1; inset: calc(var(--b, 0px) * -2); background-repeat: no-repeat; filter: blur(var(--b, 0px)); pointer-events: none; }
.b-bgm-parallax > .b-bgl { top: calc(var(--plx, .2) * -100% - var(--b, 0px) * 2); bottom: calc(var(--plx, .2) * -100% - var(--b, 0px) * 2); will-change: transform; }
.b-bgm-fixed { clip-path: inset(0); }
.b-bgm-fixed > .b-bgl { position: fixed; }
/* culoarea textului, peste culori si degradeuri */
.b-fg-light { color: #fff; }
.prose .b-fg-light h2, .prose .b-fg-light h3, .prose .b-fg-light h4, .prose .b-fg-light strong, .prose .b-fg-light b, .prose .b-fg-light a { color: #fff; }
.b-fg-dark { color: #2a2826; }
.prose .b-fg-dark h2, .prose .b-fg-dark h3, .prose .b-fg-dark h4, .prose .b-fg-dark strong, .prose .b-fg-dark b, .prose .b-fg-dark a { color: #0a0a0a; }
.prose .b-fg-dark hr { border-top-color: rgba(0,0,0,.2); }
/* spatierea, latimea si asezarea sectiunii */
.prose .b-sec.b-pad-none { margin: 0; }
.prose .b-sec.b-pad-none:not(.b-bg-none) { padding-top: 0; padding-bottom: 0; margin-left: calc(50% - 50vw); margin-right: calc(50% - 50vw); }
.prose .b-sec.b-pad-xl { margin: 128px 0; }
.prose .b-sec.b-pad-xl:not(.b-bg-none) { margin-top: 0; margin-bottom: 0; padding-top: clamp(110px, 14vw, 200px); padding-bottom: clamp(110px, 14vw, 200px); }
.prose .b-sec.b-w-full { margin-left: calc(50% - 50vw); margin-right: calc(50% - 50vw); padding-left: var(--pad); padding-right: var(--pad); }
.prose .b-pos-center > div.b-row { width: 100%; margin-left: auto; margin-right: auto; }
.prose .b-pos-right > div.b-row { width: 100%; margin-left: auto; }
.prose .b-mh-40 { min-height: 40vh; } .prose .b-mh-60 { min-height: 60vh; } .prose .b-mh-80 { min-height: 80vh; } .prose .b-mh-100 { min-height: 100vh; min-height: 100svh; }
.prose .b-sec[class*="b-mh-"] { display: grid; align-content: start; }
.prose .b-sec.b-va-center { align-content: center; } .prose .b-sec.b-va-bottom { align-content: end; }
.prose .b-va-center > div.b-row { align-items: center; } .prose .b-va-bottom > div.b-row { align-items: end; }
.b-ta-left > .b-row { text-align: left; } .b-ta-center > .b-row { text-align: center; } .b-ta-right > .b-row { text-align: right; }
.b-ta-justify > .b-row p:not(.b-btns), .b-ta-justify > .b-row li { text-align: justify; hyphens: auto; -webkit-hyphens: auto; }
.prose .b-ta-center h2::before, .prose .b-ta-center .b-img { margin-left: auto; margin-right: auto; }
.prose .b-ta-right h2::before, .prose .b-ta-right .b-img { margin-left: auto; }
/* latimea si alinierea imaginilor */
.prose .b-img.b-wd-75 { width: 75%; } .prose .b-img.b-wd-66 { width: 66.66%; } .prose .b-img.b-wd-50 { width: 50%; } .prose .b-img.b-wd-33 { width: 33.33%; } .prose .b-img.b-wd-25 { width: 25%; }
.prose .b-img.b-al-left { margin-left: 0; margin-right: auto; } .prose .b-img.b-al-center { margin-left: auto; margin-right: auto; } .prose .b-img.b-al-right { margin-left: auto; margin-right: 0; }
.prose .b-btns.ql-align-justify a.b-btn { display: flex; justify-content: center; width: 100%; }
/* blocuri */
.prose .b-img { margin: 34px 0; }
.prose .b-img img { display: block; width: 100%; max-width: 100%; margin: 0; }
.prose .b-img a { display: block; text-decoration: none; }
.b-img.r-1-1 img { aspect-ratio: 1; object-fit: cover; } .b-img.r-4-3 img { aspect-ratio: 4 / 3; object-fit: cover; }
.b-img.r-3-2 img { aspect-ratio: 3 / 2; object-fit: cover; } .b-img.r-16-9 img { aspect-ratio: 16 / 9; object-fit: cover; }
.b-img.r-3-4 img { aspect-ratio: 3 / 4; object-fit: cover; }
.prose .b-img figcaption { margin-top: 12px; font-size: 14px; line-height: 1.5; color: var(--mu); }
.prose div.b-gal { display: grid; grid-template-columns: repeat(3, minmax(0, 1fr)); gap: 10px; margin: 34px 0; max-width: none; }
.prose div.b-gal.c-2 { grid-template-columns: repeat(2, minmax(0, 1fr)); } .prose div.b-gal.c-4 { grid-template-columns: repeat(4, minmax(0, 1fr)); }
.prose .b-gal a { display: block; overflow: hidden; background: var(--bk2); }
.prose .b-gal img { display: block; width: 100%; height: 100%; margin: 0; box-shadow: none; object-fit: cover; aspect-ratio: 1; transition: transform .6s var(--ease), opacity .3s; }
.b-gal.r-auto img { aspect-ratio: auto; } .b-gal.r-4-3 img { aspect-ratio: 4 / 3; } .b-gal.r-3-2 img { aspect-ratio: 3 / 2; }
.b-gal.r-16-9 img { aspect-ratio: 16 / 9; } .b-gal.r-3-4 img { aspect-ratio: 3 / 4; }
.prose .b-gal a:hover img { transform: scale(1.04); }
.prose .b-btns { margin: 30px 0; }
.prose a.b-btn { text-decoration: none; }
.prose a.b-btn.red { color: #fff; } .prose a.b-btn.red:hover { color: var(--bk); }
.prose a.b-btn.ghost:hover { color: #fff; }
.prose .b-bg-red a.b-btn.red { background: #fff; border-color: #fff; color: var(--red); }
.prose .b-quote { font-size: clamp(20px, 2vw, 26px); line-height: 1.5; }
.prose .b-quote p { margin: 0; max-width: none; }
.prose .b-quote cite { display: block; margin-top: 14px; font: 600 11.5px/1.4 var(--text); letter-spacing: .2em; text-transform: uppercase; font-style: normal; color: var(--mu); }
.prose .b-bg-red .b-quote cite, .prose .b-bg-image .b-quote cite { color: rgba(255,255,255,.8); }
.prose div.b-sp { display: block; margin: 0; height: 56px; } .prose div.b-sp-s { height: 24px; } .prose div.b-sp-l { height: 104px; }
@media (max-width: 760px) {
  .prose div.b-row { grid-template-columns: minmax(0, 1fr); gap: 28px; }
  .prose div.b-gal.c-3, .prose div.b-gal.c-4 { grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .prose .b-sec.b-pad-l { margin: 56px 0; }
}
/* pagina de contact: textul sta intr-o coloana, deci fundalurile nu ies din ea */
.prose--flat .b-sec:not(.b-bg-none) { margin: 24px 0; padding: 28px; }

/* categorii */
.tabs { display: flex; border-bottom: 1px solid var(--ln); position: sticky; top: 72px; z-index: 20; background: rgba(10,10,10,.94); backdrop-filter: blur(10px); -webkit-backdrop-filter: blur(10px); padding: 0 var(--pad); }
.tabs a { position: relative; padding: 20px 22px; font-size: 11.5px; font-weight: 700; letter-spacing: .2em; text-transform: uppercase; text-decoration: none; color: var(--mu); transition: color .2s; }
.tabs a::after { content: ""; position: absolute; left: 22px; right: 22px; bottom: -1px; height: 2px; background: var(--red); transform: scaleX(0); transition: transform .35s var(--ease); }
.tabs a:hover { color: #fff; }
.tabs a.on { color: #fff; } .tabs a.on::after { transform: scaleX(1); }
.list { padding: 40px var(--pad) 100px; display: grid; gap: 2px; }
.card.feature { display: grid; grid-template-columns: 1.3fr 1fr; }
.card.feature .cv { aspect-ratio: auto; min-height: 380px; }
.card.feature .card__body { justify-content: center; padding: 40px 44px; }
.grid3 { display: grid; grid-template-columns: repeat(3, 1fr); gap: 2px; }
.none { padding: 80px var(--pad); color: var(--mu); font-size: 17px; }

/* articol */
.a-progress { position: fixed; z-index: 45; top: 72px; left: 0; right: 0; height: 3px; pointer-events: none; }
.a-progress span { display: block; height: 100%; background: var(--red); transform-origin: 0 50%; transform: scaleX(0); }
.share { max-width: 760px; display: flex; flex-wrap: wrap; align-items: center; gap: 10px; margin-top: 56px; padding-top: 26px; border-top: 1px solid var(--ln); }
.share .lbl { margin: 0 10px 0 0; }
.share a, .share button { display: inline-flex; align-items: center; min-height: 40px; padding: 0 16px; border: 1px solid var(--ln2); background: none; color: var(--wh); font: 600 11.5px var(--text); letter-spacing: .14em; text-transform: uppercase; text-decoration: none; cursor: pointer; transition: border-color .2s, background .2s; }
.share a:hover, .share button:hover { border-color: var(--red); background: var(--red); color: #fff; }
.share [hidden] { display: none !important; }
.pshare { padding: 0 var(--pad) 46px; }
.pshare .share { max-width: none; margin-top: 0; }
.box .share { margin-top: 18px; padding-top: 18px; }
.share-prev { display: block; width: 100%; max-width: 560px; height: auto; margin: 16px 0 4px; border: 1px solid var(--ln2); }
.pn { display: grid; grid-template-columns: 1fr 1fr; border-top: 1px solid var(--ln); border-bottom: 1px solid var(--ln); }
.pn a { display: flex; flex-direction: column; gap: 10px; padding: 34px var(--pad); text-decoration: none; transition: background .3s; }
.pn a.next { text-align: right; border-left: 1px solid var(--ln); grid-column: 2; }
.pn a .lbl { margin: 0; transition: color .2s; }
.pn a strong { font-size: 18px; line-height: 1.35; color: #fff; }
.pn a:hover { background: var(--red); } .pn a:hover .lbl { color: #fff; }
.more { padding: 80px 0 100px; }
.more .grid3 { padding: 0 var(--pad); }

/* contact */
.c-wrap { max-width: 1240px; margin: 0 auto; display: grid; grid-template-columns: 1fr 1.25fr; gap: 2px; padding: clamp(40px, 5vw, 70px) var(--pad) 90px; }
.c-info, .c-box { background: var(--bk2); padding: clamp(28px, 3.4vw, 46px); }
.c-data h2, .c-box h2 { margin: 0 0 6px; font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(28px, 2.6vw, 38px); line-height: 1.05; }
.c-org { margin: 0 0 22px; color: var(--wh2); font-weight: 600; }
.c-row { display: grid; grid-template-columns: 44px 1fr; gap: 16px; align-items: center; padding: 16px 0; border-top: 1px solid var(--ln); }
.c-row .lbl { display: block; margin: 0 0 3px; }
.c-row a { color: #fff; text-decoration: none; font-size: 17px; }
.c-row a:hover { color: var(--red-t); }
.c-row span:not(.lbl):not(.c-ic) { color: var(--wh2); }
.c-ic { width: 44px; height: 44px; display: grid; place-items: center; border: 1px solid var(--ln2); color: var(--red-t); }
.c-ic svg { width: 19px; height: 19px; fill: none; stroke: currentColor; stroke-width: 1.6; stroke-linecap: round; stroke-linejoin: round; }
.c-map { margin-top: 24px; }
.c-form .fl { max-width: none; }
.c-form .btn { margin-top: 6px; min-width: 200px; }
.c-sent { text-align: left; }
.c-sent__ic { width: 56px; height: 56px; display: grid; place-items: center; background: var(--red); color: #fff; font-size: 26px; margin-bottom: 20px; }
.c-sent p { color: var(--wh2); margin: 8px 0 24px; }

/* ---------- prima pagina ---------- */
.h-hero { position: relative; min-height: 100vh; min-height: 100svh; display: flex; align-items: flex-end; overflow: hidden; isolation: isolate; }
.h-hero__bg { position: absolute; inset: 0; z-index: -2; background: var(--bk) center right / cover no-repeat; filter: grayscale(.25) brightness(.5); transform: scale(1.08); animation: kb 22s ease-in-out infinite alternate; }
@keyframes kb { to { transform: scale(1.18) translate(-2%, -1%); } }
.h-hero::before { content: ""; position: absolute; inset: 0; z-index: -1; background: radial-gradient(80% 70% at 85% 30%, rgba(200,16,46,.28), transparent 60%), linear-gradient(90deg, rgba(10,10,10,.96) 0%, rgba(10,10,10,.75) 40%, rgba(10,10,10,.25) 78%), linear-gradient(0deg, var(--bk) 0%, transparent 35%); }
.h-hero__in { width: 100%; padding: 120px var(--pad) 84px; display: grid; grid-template-columns: 1fr minmax(280px, 360px); gap: 40px; align-items: end; }
.h-k { display: inline-flex; align-items: center; gap: 12px; color: var(--red-t); margin-bottom: 22px; }
.h-k::before { content: ""; width: 34px; height: 2px; background: var(--red); }
.h-title { margin: 0; font-size: clamp(54px, 9vw, 150px); line-height: 1.02; }
.h-title span { display: block; overflow: hidden; padding-top: .08em; margin-top: -.08em; }
.h-title b { display: block; font-weight: 400; animation: up 1.1s var(--ease) both; }
.h-title span:nth-child(2) b { animation-delay: .12s; } .h-title span:nth-child(3) b { animation-delay: .24s; }
@keyframes up { from { transform: translateY(105%); } }
.h-btns { display: flex; gap: 12px; flex-wrap: wrap; margin-top: 34px; animation: fade 1s .6s both; }
@keyframes fade { from { opacity: 0; } }
.h-latest { display: block; background: rgba(18,18,18,.78); backdrop-filter: blur(10px); -webkit-backdrop-filter: blur(10px); border: 1px solid rgba(255,255,255,.12); border-top: 3px solid var(--red); padding: 22px 24px; text-decoration: none; color: var(--wh); animation: fade 1s .9s both; transition: transform .4s var(--ease), border-color .3s; }
.h-latest:hover { transform: translateY(-4px); border-color: rgba(255,255,255,.3); color: var(--wh); }
.h-latest .lbl { color: var(--red-t); }
.h-latest strong { display: block; margin: 10px 0 10px; font-size: 18px; line-height: 1.35; }
.h-latest__go { font-size: 13px; color: var(--mu); }
.h-scroll { position: absolute; left: 50%; bottom: 22px; width: 1px; height: 46px; background: linear-gradient(var(--wh), transparent); animation: sc 2s infinite; }
@keyframes sc { 0% { transform: scaleY(0); transform-origin: top; } 50% { transform: scaleY(1); transform-origin: top; } 51% { transform-origin: bottom; } 100% { transform: scaleY(0); transform-origin: bottom; } }
.h-tiles { display: grid; grid-template-columns: repeat(3, 1fr); gap: 2px; padding: 90px var(--pad) 0; }
.h-tile { position: relative; height: 380px; overflow: hidden; display: flex; flex-direction: column; justify-content: flex-end; padding: 30px; isolation: isolate; text-decoration: none; color: #fff; }
.h-tile img { position: absolute; inset: 0; width: 100%; height: 100%; object-fit: cover; z-index: -2; filter: grayscale(1) brightness(.55); transform: scale(1.04); transition: transform 1.2s var(--ease), filter .6s; }
.h-tile::before { content: ""; position: absolute; inset: 0; z-index: -1; background: linear-gradient(0deg, rgba(10,10,10,.95), rgba(10,10,10,.1) 70%); transition: opacity .5s; }
.h-tile::after { content: ""; position: absolute; inset: 0; z-index: -1; background: linear-gradient(0deg, rgba(200,16,46,.92), rgba(200,16,46,.15) 75%); opacity: 0; transition: opacity .5s; }
.h-tile:hover { color: #fff; }
.h-tile:hover img { transform: scale(1.12); filter: grayscale(0) brightness(.6); }
.h-tile:hover::after { opacity: 1; }
.h-tile .lbl { color: var(--red-t); transition: color .3s; margin: 0; } .h-tile:hover .lbl { color: #fff; }
.h-tile strong { font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(36px, 3.6vw, 56px); line-height: 1; margin-top: 8px; }
.h-tile__n { position: absolute; top: 24px; right: 28px; font-family: var(--display); font-size: 18px; color: rgba(255,255,255,.5); }
.h-tile i { font-style: normal; position: absolute; right: 28px; bottom: 34px; font-size: 26px; transition: transform .4s var(--ease); }
.h-tile:hover i { transform: translate(6px, -6px); }
.h-intro { display: grid; grid-template-columns: 220px 1fr; gap: 40px; padding: 110px var(--pad); }
.h-intro p { margin: 0; font-size: clamp(22px, 2.5vw, 36px); line-height: 1.42; color: var(--wh2); max-width: 1050px; }
.h-intro strong { color: #fff; font-weight: 700; background: linear-gradient(var(--red), var(--red)) 0 92% / 100% 4px no-repeat; }
.h-mag { display: grid; grid-template-columns: 1.25fr 1fr; gap: 2px; padding: 0 var(--pad) 110px; }
.h-mag__side { display: grid; grid-template-rows: repeat(3, 1fr); gap: 2px; }
.h-gal { display: grid; grid-template-columns: 2fr 1fr 1fr; grid-template-rows: 260px 260px; gap: 2px; padding: 0 var(--pad); }
.h-gal figure { margin: 0; overflow: hidden; position: relative; background: var(--bk3); }
.h-gal figure:first-child { grid-row: span 2; }
.h-gal img { width: 100%; height: 100%; object-fit: cover; display: block; filter: grayscale(1) contrast(1.05); transition: filter .7s, transform 1.4s var(--ease); }
.h-gal figure:hover img { filter: none; transform: scale(1.06); }
.h-plans { margin-top: 110px; display: grid; grid-template-columns: 1fr 1fr; min-height: 640px; }
.h-plans__img { position: relative; background: var(--bk3) var(--bg) center / cover fixed; }
.h-plans__img::after { content: ""; position: absolute; inset: 0; background: linear-gradient(90deg, rgba(10,10,10,.1), rgba(10,10,10,.85)); }
.h-plans__txt { padding: 90px var(--pad); background: var(--bk2); display: flex; flex-direction: column; justify-content: center; }
.h-plans__txt h2 { margin: 0 0 40px; font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(42px, 4.6vw, 72px); line-height: 1; }
.h-plan { display: grid; grid-template-columns: 70px 1fr; gap: 20px; padding: 26px 0; border-top: 1px solid var(--ln2); }
.h-plan b { font-family: var(--display); font-weight: 400; font-size: 46px; line-height: .9; color: var(--red); }
.h-plan p { margin: 0; color: var(--wh2); font-size: 16px; line-height: 1.75; }
.h-doc { margin: 110px var(--pad) 0; display: grid; grid-template-columns: auto 1fr auto; gap: 36px; align-items: center; padding: 40px 44px; border: 1px solid var(--ln2); background: linear-gradient(120deg, rgba(200,16,46,.14), transparent 45%), var(--bk2); text-decoration: none; color: var(--wh); transition: border-color .3s; }
.h-doc:hover { border-color: rgba(255,255,255,.35); color: var(--wh); }
.h-doc__ic { width: 84px; height: 108px; border: 2px solid var(--wh); position: relative; display: grid; place-items: center; font-family: var(--display); font-size: 22px; }
.h-doc__ic::before { content: ""; position: absolute; top: -2px; right: -2px; width: 22px; height: 22px; background: #151515; border-left: 2px solid var(--wh); border-bottom: 2px solid var(--wh); }
.h-doc .lbl { margin: 0; }
.h-doc h3 { margin: 10px 0 10px; font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(22px, 2.2vw, 30px); line-height: 1.28; }
.h-doc p { margin: 0; color: var(--mu); font-size: 14.5px; }
.h-part { margin-top: 110px; border-top: 1px solid var(--ln); border-bottom: 1px solid var(--ln); display: grid; grid-template-columns: 280px 1fr; }
.h-part h2 { margin: 0; padding: 34px var(--pad); font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: 26px; line-height: 1.05; border-right: 1px solid var(--ln); display: flex; align-items: center; }
.h-marq { overflow: hidden; -webkit-mask-image: linear-gradient(90deg, transparent, #000 8%, #000 92%, transparent); mask-image: linear-gradient(90deg, transparent, #000 8%, #000 92%, transparent); }
.h-marq > div { display: inline-flex; padding: 26px 0; animation: tk 34s linear infinite; }
.h-marq__copy { display: inline-flex; }
.h-marq > div > a, .h-marq > div > span:not(.h-marq__copy), .h-marq__copy > * { display: block; flex: 0 0 auto; margin-right: 14px; }
.h-marq img { height: 96px; width: 150px; object-fit: contain; padding: 14px; background: #f3f0eb; filter: grayscale(1); opacity: .8; transition: opacity .3s, filter .4s, transform .4s var(--ease); display: block; }
.h-marq img:hover { opacity: 1; filter: none; transform: translateY(-3px); }
.h-cta { position: relative; overflow: hidden; display: flex; justify-content: space-between; align-items: center; gap: 40px; padding: 70px var(--pad); background: var(--red); }
.h-cta::before { content: attr(data-mark); position: absolute; right: -2%; top: 50%; transform: translateY(-50%); font-family: var(--display); font-size: 260px; line-height: 1; color: rgba(0,0,0,.12); pointer-events: none; }
.h-cta p { position: relative; margin: 0; max-width: 820px; font-size: clamp(20px, 2vw, 28px); line-height: 1.4; color: #fff; font-weight: 500; }
.h-cta .btn { position: relative; flex: 0 0 auto; }

/* documentul din Utile (card) */
.d-card { position: relative; display: block; max-width: 760px; margin: 40px 0 0; padding: 30px 74px 30px 30px; border: 1px solid var(--ln2); background: linear-gradient(120deg, rgba(200,16,46,.14), transparent 50%), var(--bk2); text-decoration: none !important; transition: border-color .3s; }
.d-card .lbl { display: block; margin: 0 0 10px; color: var(--red-t); }
.d-card strong { display: block; font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(22px, 2.4vw, 30px); line-height: 1.26; color: #fff; }
.d-card__m { display: block; margin-top: 12px; font-size: 14px; color: var(--mu); }
.d-card__go { position: absolute; right: 28px; top: 50%; transform: translateY(-50%); font-size: 30px; color: var(--mu); transition: transform .3s var(--ease), color .3s; }
.d-card:hover { border-color: rgba(255,255,255,.4); }
.d-card:hover .d-card__go { color: var(--red-t); transform: translate(6px, -50%); }

@media (max-width: 1100px) {
  .h-hero__in { grid-template-columns: 1fr; }
  .h-mag, .card.feature { grid-template-columns: 1fr; }
  .card.feature .cv { min-height: 0; aspect-ratio: 16 / 9; }
  .grid3 { grid-template-columns: 1fr 1fr; }
}
@media (max-width: 980px) {
  .top__cta { padding: 0 16px; font-size: 10.5px; letter-spacing: .14em; }
  .nav__acc { padding: 0 14px; }
  .mnav__m { display: block; padding: 22px var(--pad); }
  .mnav__m .nav__tel { font-size: 18px; }
  .h-tiles { grid-template-columns: 1fr; padding-top: 60px; }
  .h-tile { height: 240px; }
  .h-intro, .h-plans, .h-part, .h-doc, .c-wrap { grid-template-columns: 1fr; }
  .h-intro { gap: 18px; padding: 70px var(--pad); }
  .h-gal { grid-template-columns: 1fr 1fr; grid-template-rows: repeat(3, 180px); }
  .h-plans__img { min-height: 300px; background-attachment: scroll; }
  .h-plans__txt { padding: 60px var(--pad); }
  .h-part h2 { border-right: 0; border-bottom: 1px solid var(--ln); padding: 26px var(--pad); }
  .h-doc { gap: 20px; padding: 30px 24px; margin-top: 70px; }
  .h-cta { flex-direction: column; align-items: flex-start; padding: 56px var(--pad); }
  .h-cta::before { font-size: 160px; }
  .tabs { top: 72px; overflow-x: auto; }
  .tabs a { white-space: nowrap; }
}
@media (max-width: 760px) {
  .h-hero__in { padding: 110px var(--pad) 70px; gap: 28px; }
  .h-title { font-size: clamp(46px, 14vw, 80px); }
  .h-btns .btn { flex: 1 1 auto; justify-content: center; }
  .h-latest { padding: 18px 20px; }
  .h-scroll { display: none; }
  .sec-h { flex-direction: column; align-items: flex-start; gap: 14px; }
  .h-mag { padding-bottom: 70px; }
  .card--row { flex-direction: column; }
  .card--row .cv { flex: none; aspect-ratio: 16 / 9; }
  .grid3 { grid-template-columns: 1fr; }
  .list { padding: 24px var(--pad) 70px; }
  .card.feature .card__body, .card.big .card__body { padding: 24px 22px 28px; }
  .prose { font-size: 17px; line-height: 1.75; }
  .pn { grid-template-columns: 1fr; }
  .pn a.next { grid-column: 1; border-left: 0; border-top: 1px solid var(--ln); text-align: left; }
  .c-wrap { padding: 32px var(--pad) 70px; }
}

/* ---------- documente de citit (ex. Normele de igiena) ----------
   Lectura lunga: grafit cald in loc de negru, text cald, randuri aerisite, marcaje intr-un rosu bland. */
.d-page { --ink: #e6e1d9; --ink2: #c9c3ba; --sheet: #141414; --sheet2: #1a1a1a; --rule: #2a2a2a; --mark: #e8566b; }
.d-progress { position: fixed; z-index: 45; top: 72px; left: 0; right: 0; height: 3px; pointer-events: none; }
.d-progress span { display: block; height: 100%; background: var(--red); transform-origin: 0 50%; transform: scaleX(0); }
.d-hero h1 { font-size: clamp(34px, 4.6vw, 72px); max-width: 1120px; line-height: 1.16; }
.d-hero .p-kick span { color: var(--red-t); }
.d-hero__act { margin: 18px 0 0; font-size: 16px; color: var(--wh2); }
.d-stats { display: flex; flex-wrap: wrap; margin: 32px 0 8px; border-top: 1px solid rgba(255,255,255,.14); border-bottom: 1px solid rgba(255,255,255,.14); }
.d-stats > div { padding: 18px 32px 16px 0; margin-right: 32px; border-right: 1px solid rgba(255,255,255,.1); }
.d-stats > div:last-child { border-right: 0; }
.d-stats b { display: block; font-family: var(--display); font-weight: 400; font-size: 44px; line-height: 1; color: #fff; }
.d-stats b small { font-size: 18px; margin-left: 4px; color: var(--mu); }
.d-stats .lbl { margin: 6px 0 0; }
.d-hero .btnrow { margin-top: 26px; }
.d-chips { display: grid; grid-template-columns: repeat(3, 1fr); gap: 2px; padding: 2px; background: var(--bk); }
.d-chips a { position: relative; display: flex; flex-direction: column; gap: 8px; padding: 24px var(--pad); background: var(--bk2); text-decoration: none; transition: background .3s; overflow: hidden; }
.d-chips a::after { content: "→"; position: absolute; right: 22px; bottom: 20px; color: var(--mu); transition: transform .3s var(--ease), color .3s; }
.d-chips a .lbl { margin: 0; color: var(--red-t); }
.d-chips a strong { font-size: 15.5px; line-height: 1.38; color: #fff; font-weight: 600; padding-right: 24px; }
.d-chips a:hover { background: var(--bk3); }
.d-chips a:hover::after { color: var(--red-t); transform: translateX(5px); }
.d-wrap { display: grid; grid-template-columns: 320px minmax(0, 1fr); background: var(--sheet); }
.d-side { border-right: 1px solid var(--rule); background: #101010; }
.d-side__in { position: sticky; top: 75px; max-height: calc(100vh - 75px); display: flex; flex-direction: column; }
.d-search { padding: 20px 20px 0; }
.d-search input { min-height: 46px; font-size: 15px; background: #181818; border-color: #2f2f2f; }
.d-search__r { display: flex; align-items: center; gap: 6px; padding-top: 8px; font-size: 13px; color: var(--mu); }
.d-search__r span { flex: 1; }
.d-search__r button { width: 34px; height: 30px; border: 1px solid var(--ln2); background: none; color: var(--wh); cursor: pointer; }
.d-search__r button:hover { background: var(--red); border-color: var(--red); }
.d-mode { display: flex; align-items: center; gap: 10px; margin: 14px 20px 0; padding: 0; border: 0; background: none; color: var(--wh2); font: 600 11px var(--text); letter-spacing: .18em; text-transform: uppercase; cursor: pointer; }
.d-mode .dot { width: 30px; height: 16px; border: 1px solid var(--ln2); position: relative; transition: background .2s; }
.d-mode .dot::after { content: ""; position: absolute; top: 2px; left: 2px; width: 10px; height: 10px; background: var(--mu); transition: transform .2s, background .2s; }
.d-mode[aria-pressed="true"] .dot { background: var(--red); border-color: var(--red); }
.d-mode[aria-pressed="true"] .dot::after { transform: translateX(14px); background: #fff; }
.d-side__h { margin: 24px 20px 8px; }
.d-toc { overflow-y: auto; padding: 0 0 24px; scrollbar-width: thin; scrollbar-color: #333 transparent; }
.d-toc a { display: block; padding: 9px 20px; border-left: 2px solid transparent; font-size: 13.5px; line-height: 1.42; color: #a7a29b; text-decoration: none; transition: background .2s, color .2s; }
.d-toc a span { display: block; font-size: 10px; font-weight: 700; letter-spacing: .2em; text-transform: uppercase; color: #5e5a55; margin-bottom: 2px; transition: color .2s; }
.d-toc a em { display: block; font-style: normal; font-size: 11.5px; color: #5e5a55; margin-top: 2px; }
.d-toc a.l1 { color: var(--wh2); font-weight: 600; margin-top: 8px; }
.d-toc a.l3 { padding-left: 34px; font-size: 13px; }
.d-toc a:hover { color: #fff; background: #181818; }
.d-toc a.on { color: #fff; border-left-color: var(--red); background: linear-gradient(90deg, rgba(200,16,46,.16), transparent); }
.d-toc a.on span { color: var(--red-t); }
.d-main { min-width: 0; padding: 0 var(--pad) 80px; background: radial-gradient(60% 400px at 50% 0%, rgba(200,16,46,.06), transparent 70%), var(--sheet); transition: background .3s, color .3s; }
.d-note { max-width: 780px; margin: 44px auto 0; padding: 18px 22px; background: var(--sheet2); border-left: 3px solid var(--red); font-size: 14px; line-height: 1.65; color: var(--ink2); }
.d-note strong { color: #fff; font-weight: 600; }
.d-note a { color: #fff; }
.d-text { max-width: 780px; margin: 0 auto; font-size: 18px; line-height: 1.85; letter-spacing: .003em; color: var(--ink); overflow-wrap: break-word; }
.d-text p { margin: 0 0 14px; }
.d-text [id] { scroll-margin-top: 100px; }
.d-ordin { margin: 60px 0 30px; padding: 44px 30px 38px; background: var(--sheet2); border-top: 3px solid var(--red); text-align: center; }
.d-inst { margin: 0 0 10px !important; font-size: 12px; font-weight: 700; letter-spacing: .28em; text-transform: uppercase; color: var(--mu); }
.d-act { margin: 6px 0 14px; font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(40px, 4.6vw, 60px); line-height: 1; letter-spacing: .02em; color: #fff; }
.d-act__sub { max-width: 620px; margin: 0 auto !important; font-size: 16.5px; line-height: 1.6; color: var(--ink); }
.d-pre { color: var(--ink2); font-style: italic; }
.d-art { position: relative; padding: 30px 0 14px; border-top: 1px solid var(--rule); }
.d-art__h { margin: 0 0 12px; font-family: var(--display); font-weight: 400; font-size: 25px; letter-spacing: .02em; line-height: 1; display: flex; align-items: center; gap: 12px; }
.d-art__h::before { content: ""; width: 18px; height: 2px; background: var(--red); }
.d-art__h a { color: #fff; text-decoration: none; }
.d-art__h a::after { content: "#"; margin-left: 10px; font-family: var(--text); font-size: 15px; font-weight: 700; color: var(--mark); opacity: 0; transition: opacity .2s; }
.d-art:hover .d-art__h a::after, .d-art__h a:focus-visible::after { opacity: 1; }
.d-art:target { background: linear-gradient(90deg, rgba(200,16,46,.1), transparent 75%); box-shadow: -20px 0 0 rgba(200,16,46,.1); }
.d-al, .d-lit, .d-num, .d-big { position: relative; padding-left: 48px; }
.d-lit { padding-left: 78px; }
.d-l2 { padding-left: 114px; }
.d-m { position: absolute; left: 0; width: 40px; font-weight: 600; color: var(--mark); font-variant-numeric: tabular-nums; }
.d-lit .d-m { left: 48px; width: 28px; }
.d-l2 .d-m { left: 78px; width: 34px; font-weight: 500; }
.d-big { margin-top: 26px !important; padding-top: 16px; border-top: 1px dashed #333; color: #f2eee8; }
.d-big .d-m { font-family: var(--display); font-weight: 400; font-size: 26px; line-height: 1.1; top: 14px; }
.d-text b { color: #fff; font-weight: 700; }
.d-sign { margin: 34px 0 10px; text-align: right; font-size: 15px; line-height: 1.55; color: var(--ink2); }
.d-sign p { margin: 0 !important; }
.d-sign__name { font-weight: 700; color: #fff; }
.d-sign p:nth-child(n+3) { text-align: left; color: var(--mu); }
.d-annex { margin: 80px 0 0; display: flex; align-items: center; gap: 18px; }
.d-annex::before, .d-annex::after { content: ""; flex: 1; height: 1px; background: linear-gradient(90deg, transparent, #3a3a3a, transparent); }
.d-annex span { font-size: 12px; font-weight: 700; letter-spacing: .32em; text-transform: uppercase; color: var(--red-t); }
.d-norme { margin: 24px 0 34px; text-align: center; }
.d-cap { position: relative; margin: 84px 0 10px; padding: 34px 0 22px; border-top: 1px solid #333; overflow: hidden; }
.d-cap__big { position: absolute; right: 0; top: 6px; font-family: var(--display); font-size: clamp(90px, 10vw, 150px); line-height: 1; color: transparent; -webkit-text-stroke: 1.5px rgba(255,255,255,.16); pointer-events: none; }
.d-cap__n { position: relative; display: inline-block; font-size: 12px; font-weight: 700; letter-spacing: .26em; color: #fff; background: var(--red); padding: 6px 12px; margin-bottom: 16px; }
.d-cap h2 { position: relative; margin: 0; max-width: 620px; font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(28px, 3vw, 40px); line-height: 1.2; color: #fff; }
.d-sec { margin: 48px 0 4px; padding: 20px 0 12px; border-top: 1px solid #333; }
.d-sec__n { display: block; font-size: 11px; font-weight: 700; letter-spacing: .24em; color: var(--mark); margin-bottom: 6px; }
.d-sec h3 { margin: 0; font-size: 23px; color: #fff; }
.d-table { margin: 20px 0 22px; overflow-x: auto; border: 1px solid #2f2f2f; background: var(--sheet2); }
.d-table table { width: 100%; border-collapse: collapse; font-size: 14.5px; line-height: 1.55; }
.d-table th { text-align: left; padding: 15px; background: #202020; font-size: 11px; font-weight: 700; letter-spacing: .18em; text-transform: uppercase; color: #fff; border-bottom: 2px solid var(--red); }
.d-table td { padding: 15px; vertical-align: top; border-bottom: 1px solid #2a2a2a; color: var(--ink2); }
.d-table tr:hover td { background: rgba(255,255,255,.02); }
.d-table td:nth-child(2) { color: #fff; font-weight: 600; white-space: nowrap; }
.d-table tr:last-child td { border-bottom: 0; }
.d-decl { margin: 44px 0 0; }
.d-decl__bar { display: flex; justify-content: space-between; align-items: flex-end; gap: 20px; margin-bottom: 14px; }
.d-decl__bar h3 { margin: 0; font-size: 19px; line-height: 1.35; color: #fff; }
.d-print { flex: 0 0 auto; min-height: 42px; padding: 0 18px; border: 1px solid var(--ln2); background: none; color: var(--wh); font: 700 11px var(--text); letter-spacing: .18em; text-transform: uppercase; cursor: pointer; transition: background .2s, border-color .2s; }
.d-print:hover { background: var(--red); border-color: var(--red); }
/* modelul de declaratie: pe ecran in culorile paginii, alb doar la printare */
.d-paper { position: relative; padding: 40px 44px; background: var(--sheet2); border: 1px solid #2f2f2f; border-top: 3px solid var(--red); color: var(--ink); font-family: Georgia, 'Times New Roman', serif; font-size: 16px; line-height: 1.8; }
.d-paper p { margin: 0 0 12px !important; color: var(--ink); overflow-wrap: anywhere; }
.d-paper .dd-antet { font-family: var(--text); font-size: 11px; letter-spacing: .2em; text-transform: uppercase; color: var(--mu); border: 1px dashed #444; display: inline-block; padding: 8px 14px; }
.d-paper .dd-h { text-align: center; font-weight: 700; letter-spacing: .06em; margin-bottom: 4px !important; color: #fff; }
.d-paper .dd-note { float: right; width: 200px; margin: 0 0 14px 22px !important; padding: 14px; border: 1px solid #3a3a3a; font-size: 13px; line-height: 1.55; font-style: italic; color: var(--ink2); }
.d-paper .dd-sig { color: var(--ink2); }
.d-end { max-width: 780px; margin: 56px auto 0; display: flex; flex-wrap: wrap; gap: 12px; padding-top: 30px; border-top: 1px solid var(--rule); }
mark.d-hit { background: rgba(255,200,80,.25); color: #fff; padding: 0 1px; }
mark.d-hit.on { background: #ffc850; color: #111; box-shadow: 0 0 0 3px rgba(255,200,80,.3); }
.d-fab { display: none; }
/* mod hartie (optional): doar coloana de text devine deschisa */
.d-paper-on .d-main { background: #f3f0eb; }
.d-paper-on .d-text, .d-paper-on .d-text p, .d-paper-on .d-note, .d-paper-on .d-paper p, .d-paper-on .d-act__sub, .d-paper-on .d-table td { color: #2a2826; }
.d-paper-on .d-text b, .d-paper-on .d-art__h a, .d-paper-on .d-act, .d-paper-on .d-cap h2, .d-paper-on .d-sec h3, .d-paper-on .d-sign__name, .d-paper-on .d-big, .d-paper-on .d-note strong, .d-paper-on .d-decl__bar h3, .d-paper-on .d-table td:nth-child(2), .d-paper-on .d-paper .dd-h { color: #0a0a0a; }
.d-paper-on .d-note, .d-paper-on .d-ordin, .d-paper-on .d-table, .d-paper-on .d-paper { background: #fff; border-color: #ddd5ca; }
.d-paper-on .d-art, .d-paper-on .d-cap, .d-paper-on .d-sec, .d-paper-on .d-table td, .d-paper-on .d-end, .d-paper-on .d-big { border-color: #ddd5ca; }
.d-paper-on .d-m, .d-paper-on .d-sec__n, .d-paper-on .d-annex span { color: var(--red); }
.d-paper-on .d-table th { background: #ebe6de; color: #0a0a0a; }
.d-paper-on .d-print, .d-paper-on .d-end .btn.ghost { color: #0a0a0a; border-color: #b9b1a4; }
.d-paper-on .d-end .btn:not(.ghost) { background: #0a0a0a; border-color: #0a0a0a; color: #fff; }
.d-paper-on mark.d-hit { background: #ffe08a; color: #000; }
.d-paper-on .d-text a, .d-paper-on .d-note a { color: #0a0a0a; }
@media (max-width: 1100px) {
  .d-wrap { grid-template-columns: 1fr; }
  .d-side { position: fixed; z-index: 50; top: 72px; bottom: 0; left: 0; width: min(360px, 88vw); background: #101010; border-right: 1px solid var(--ln2); transform: translateX(-102%); transition: transform .3s var(--ease); }
  .d-open .d-side { transform: none; box-shadow: 30px 0 60px rgba(0,0,0,.6); }
  .d-side__in { position: static; height: 100%; max-height: none; }
  .d-fab { display: flex; align-items: center; gap: 10px; position: fixed; z-index: 51; left: 16px; bottom: calc(16px + env(safe-area-inset-bottom)); min-height: 48px; padding: 0 20px; border: 0; background: var(--red); color: #fff; font: 700 11.5px var(--text); letter-spacing: .2em; text-transform: uppercase; box-shadow: 0 10px 30px rgba(0,0,0,.5); cursor: pointer; }
  .d-fab::before { content: "☰"; font-size: 15px; letter-spacing: 0; }
  .d-chips { grid-template-columns: 1fr 1fr; }
}
@media (max-width: 760px) {
  .d-chips { grid-template-columns: 1fr; }
  .d-chips a { padding: 18px var(--pad); }
  .d-stats > div { padding-right: 18px; margin-right: 18px; }
  .d-stats b { font-size: 32px; }
  .d-text { font-size: 17px; line-height: 1.8; }
  .d-al, .d-num, .d-big { padding-left: 34px; }
  .d-lit { padding-left: 52px; }
  .d-lit .d-m { left: 22px; width: 28px; }
  .d-l2 { padding-left: 82px; }
  .d-l2 .d-m { left: 50px; }
  .d-ordin { padding: 32px 18px 28px; }
  .d-cap__big { font-size: 80px; }
  .d-table table, .d-table thead, .d-table tbody, .d-table tr, .d-table td { display: block; }
  .d-table thead { display: none; }
  .d-table tr { padding: 14px; border-bottom: 1px solid var(--ln2); }
  .d-table td { padding: 4px 0; border: 0; white-space: normal !important; }
  .d-table td::before { content: attr(data-k); display: block; font-size: 10px; font-weight: 700; letter-spacing: .18em; text-transform: uppercase; color: var(--mu); margin-top: 6px; }
  .d-paper { padding: 26px 20px; font-size: 15px; }
  .d-paper .dd-note { float: none; width: auto; margin: 0 0 14px !important; }
  .d-decl__bar { flex-direction: column; align-items: flex-start; }
  .d-card { padding: 22px 56px 22px 20px; }
}
@media print {
  .d-progress, .d-side, .d-fab, .d-chips, .d-hero .btnrow, .d-end, .d-print, .crumb, .a-progress, .share, .pn, .more { display: none !important; }
  .d-wrap { display: block; background: #fff; }
  .d-main { padding: 0; background: #fff !important; }
  .d-text, .d-text p, .d-note, .d-art__h a, .d-act, .d-act__sub, .d-cap h2, .d-sec h3, .d-text b, .d-table td, .d-sign, .d-m { color: #000 !important; }
  .d-ordin, .d-note, .d-table { background: #fff !important; }
  .d-cap__big { display: none; }
  .d-paper { box-shadow: none; background: #fff !important; border: 0; padding: 0; color: #000; }
  .d-paper p, .d-paper .dd-h, .d-paper .dd-sig, .d-paper .dd-note { color: #000 !important; }
  .d-printing .top, .d-printing .ticker, .d-printing .pillars, .d-printing .foot, .d-printing .d-hero, .d-printing .d-note { display: none !important; }
  .d-printing .d-text > *:not(.d-printme) { display: none !important; }
  .d-printing .d-printme .d-decl__bar { display: none; }
  .d-printing .d-printme { margin: 0; }
}

/* ---------- ecrane mici ---------- */
@media (max-width: 1180px) {
  .nav__item > a { padding: 0 12px; letter-spacing: .14em; }
  .tiles { grid-template-columns: repeat(3, 1fr); }
  .spec { grid-template-columns: repeat(2, 1fr); }
  .spec > div:nth-child(2) { border-right: 0; }
  .spec > div:nth-child(-n+2) { border-bottom: 1px solid var(--ln); }
}
@media (max-width: 980px) {
  :root { --pad: 20px; }
  .burger { display: flex; }
  /* inaltimea e data explicit: bara de sus are backdrop-filter, deci „bottom: 0” s-ar calcula fata de ea (meniu de 0 px) */
  .mnav { position: fixed; top: 72px; left: 0; right: 0; bottom: auto; height: calc(100vh - 72px); height: calc(100dvh - 72px); flex-direction: column; background: var(--bk); overflow-y: auto; transform: translateX(100%); transition: transform .3s cubic-bezier(.2,.7,.2,1); }
  .menu-open .mnav { transform: none; }
  .top { overflow-x: clip; } /* meniul inchis sta in dreapta, in afara ecranului: nu trebuie sa lase pagina sa se deruleze lateral */
  .nav__item { border-left: 0; border-bottom: 1px solid var(--ln); flex-direction: column; }
  .nav__item > a { padding: 18px var(--pad); font-family: var(--display); font-size: 30px; font-weight: 400; letter-spacing: .02em; }
  .nav__item > a i, .nav__item > a::after { display: none; }
  .nav__sub { position: static; display: block; border: 0; border-top: 1px solid var(--ln); }
  .nav__sub a { padding: 14px var(--pad) 14px calc(var(--pad) + 18px); }
  .nav__acc span { display: none; }
  .grid2, .grid2.wide-left, .row2, .dues, .signrow, .cat .catrow, .checks.cols-2, .pmain, .foot__grid { grid-template-columns: 1fr; }
  .pmain > div + div { border-left: 0; border-top: 1px solid var(--ln); }
  .foot__grid > div { border-right: 0; border-bottom: 1px solid var(--ln); }
  .pillars { grid-template-columns: 1fr 1fr; }
  .pillar:nth-child(2) { border-right: 0; }
  .pillar:nth-child(-n+2) { border-bottom: 1px solid var(--ln); }
  .filters { flex-wrap: wrap; position: static; }
  .filters input[type=search] { flex: 1 1 100%; border-right: 0; border-bottom: 1px solid var(--ln); }
  .filters select { flex: 1; }
  .filters .cats { flex: 1 1 100%; overflow-x: auto; border-top: 1px solid var(--ln); }
  .filters .cats button { padding: 18px; white-space: nowrap; }
  .tiles { grid-template-columns: repeat(2, 1fr); }
  .tile .who { left: 14px; right: 14px; bottom: 14px; }
  .tile .who h3 { font-size: 21px; }
  .tile .num { left: 14px; top: 14px; }
  .mhero .k-row { flex-direction: column; }
  .stats b { font-size: 38px; }
  .pbar { top: 72px; }
  .pbar .mid span, .pbar .lbl-m { display: none; }
  .pbar > * { padding: 0 16px; }
  .band { height: 62vh; }
  .band.empty { height: 300px; }
  .lb { padding: 60px 12px; } .lb__nav { top: auto; bottom: 14px; transform: none; width: 48px; height: 48px; }
  .ident { grid-template-columns: auto 1fr; gap: 14px; padding-bottom: 22px; }
  .ident .no { display: none; }
  .ident .av { width: 60px; height: 60px; font-size: 22px; }
  .ident .sub { gap: 12px; font-size: 11px; }
  .verify-band { flex-direction: column; align-items: flex-start; }
}
@media (max-width: 760px) {
  body { font-size: 16px; }
  .page, .paper { padding: 40px var(--pad) 60px; }
  .checks.cols-3 { grid-template-columns: repeat(2, auto); }
  .styles-pick { grid-template-columns: repeat(2, minmax(0, 1fr)) !important; }
  .steps { display: flex; list-style: none; margin: 22px 0 6px; padding: 0; gap: 0; counter-reset: s; border: 1px solid var(--ln); }
  .steps li { flex: 1; font-size: 10.5px; font-weight: 600; letter-spacing: .1em; text-transform: uppercase; text-align: center; color: var(--mu); cursor: pointer; padding: 10px 2px 9px; border-right: 1px solid var(--ln); position: relative; }
  .steps li:last-child { border-right: 0; }
  .steps li::before { counter-increment: s; content: counter(s); display: block; font-family: var(--display); font-size: 20px; letter-spacing: 0; color: var(--mu); }
  .steps li.is-on { color: #fff; background: var(--red); }
  .steps li.is-on::before { color: #fff; }
  .steps li.is-done::before { color: var(--red-t); }
  .step { display: none; }
  .step.is-on { display: block; }
  form > .nav { position: sticky; bottom: 0; background: rgba(10,10,10,.96); padding: 12px var(--pad) calc(12px + env(safe-area-inset-bottom)); margin: 24px calc(-1 * var(--pad)) 0; }
  form > .nav .btn { flex: 1; padding: 0 12px; }
  .pad canvas { height: 200px; }
  .stats { grid-template-columns: repeat(3, 1fr); }
  .stats div { padding: 16px var(--pad); }
  .box { padding: 22px 18px; }
  .kv td:first-child { width: 42%; }
}
@media (prefers-reduced-motion: reduce) { .track, .ticker div { animation: none; } * { scroll-behavior: auto; } }

/* ---------- tiparire: hartie alba, fara antet si subsol ---------- */
@media print {
  body { background: #fff; color: #000; }
  .top, .ticker, .pillars, .foot, .no-print, .pbar, .filters, .tabs, .pn, .share, .more, .a-progress { display: none !important; }
  body::after { display: none; }
  .p-head, .p-head::before { background: #fff !important; color: #000; } .p-head__bg { display: none; }
  .prose, .prose p, .prose li, .prose strong, .p-head h1 { color: #000 !important; }
  .page, .paper { padding: 0; }
  .page p, .page li, .lead, .small, .kv td { color: #000 !important; }
  .box { background: #fff; border-color: #ccc; }
}
/* butonul „Editeaza pagina” (doar pentru cine e autentificat in panou) */
.lv-edit { position: fixed; z-index: 94; left: 18px; bottom: 18px; display: inline-flex; gap: 8px; align-items: center; padding: 13px 18px; background: var(--red); color: #fff; font: 700 11.5px/1 var(--text); letter-spacing: .16em; text-transform: uppercase; text-decoration: none; box-shadow: 0 14px 34px rgba(0,0,0,.55); transition: background .2s; }
.lv-edit:hover { background: #e01438; color: #fff; }
@media print { .lv-edit { display: none; } }

/* ---------- Standardele ATPR (/standarde/) ----------
   Un manifest, nu un act normativ: capitole mari, numerotate, reguli scurte pe randuri, banda rosie la final. */
.st-hero h1 { font-size: clamp(46px, 7vw, 112px); }
.st-intro { margin: 22px 0 0; max-width: 760px; font-size: clamp(18px, 1.7vw, 22px); line-height: 1.6; color: #ece7e0; }
.st-meta { display: flex; flex-wrap: wrap; align-items: center; gap: 10px 22px; margin-top: 26px; font-size: 12px; font-weight: 600; letter-spacing: .16em; text-transform: uppercase; color: var(--mu); }
.st-badge { display: inline-flex; align-items: center; padding: 8px 12px 7px; border: 1px solid var(--ln2); color: var(--wh); letter-spacing: .18em; }
.st-badge.is-ob { background: var(--red); border-color: var(--red); color: #fff; }
.st-hero .d-stats { margin-top: 28px; }
.st-index { position: sticky; top: 72px; z-index: 15; display: flex; gap: 0; overflow-x: auto; border-bottom: 1px solid var(--ln); background: rgba(10,10,10,.94); backdrop-filter: blur(10px); -webkit-backdrop-filter: blur(10px); scrollbar-width: none; }
.st-index::-webkit-scrollbar { display: none; }
.st-index a { flex: 0 0 auto; display: flex; align-items: baseline; gap: 10px; padding: 18px 26px; border-right: 1px solid var(--ln); color: var(--wh2); font-size: 13.5px; font-weight: 600; text-decoration: none; white-space: nowrap; transition: color .2s, background .2s; }
.st-index a span { font-family: var(--display); font-size: 16px; color: var(--red-t); }
.st-index a:hover { color: #fff; background: var(--bk3); }
.st-body { max-width: 1240px; margin: 0 auto; padding: 0 var(--pad); }
.st-ch { display: grid; grid-template-columns: minmax(260px, 380px) minmax(0, 1fr); gap: clamp(28px, 5vw, 80px); padding: clamp(56px, 7vw, 100px) 0; border-bottom: 1px solid var(--ln); scroll-margin-top: 140px; }
.st-ch__h { position: sticky; top: 150px; align-self: start; }
.st-ch__big { display: block; font-family: var(--display); font-size: clamp(110px, 13vw, 200px); line-height: .8; color: transparent; -webkit-text-stroke: 1.5px rgba(255,255,255,.22); margin-bottom: 26px; transition: -webkit-text-stroke-color .5s; }
.st-ch:hover .st-ch__big { -webkit-text-stroke-color: var(--red); }
.st-ch__h .lbl { display: block; color: var(--red-t); margin-bottom: 12px; }
.st-ch__h h2 { margin: 0; font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(32px, 3.4vw, 50px); line-height: 1.12; color: #fff; }
.st-rules { list-style: none; margin: 0; padding: 0; counter-reset: none; }
.st-rules li { display: grid; grid-template-columns: 64px minmax(0, 1fr); gap: 18px; padding: 26px 0; border-top: 1px solid var(--ln); scroll-margin-top: 150px; }
.st-rules li:first-child { border-top: 0; padding-top: 6px; }
.st-rules li:target { background: linear-gradient(90deg, rgba(200,16,46,.12), transparent 70%); }
.st-r__n { font-family: var(--display); font-size: 22px; line-height: 1.2; color: var(--red-t); text-decoration: none; }
.st-r__n:hover { color: #fff; }
.st-rules p { margin: 0; font-size: clamp(17px, 1.45vw, 20px); line-height: 1.65; color: #e6e1d9; }
.st-close { position: relative; overflow: hidden; padding: clamp(56px, 7vw, 96px) max(var(--pad), calc(50vw - 620px + var(--pad))); background: var(--red); }
.st-close::after { content: "ATPR"; position: absolute; right: -2%; top: 50%; transform: translateY(-50%); font-family: var(--display); font-size: clamp(160px, 22vw, 320px); line-height: 1; color: rgba(0,0,0,.12); pointer-events: none; }
.st-close .lbl { position: relative; z-index: 1; color: rgba(255,255,255,.8); }
.st-close p { position: relative; z-index: 1; margin: 14px 0 0; max-width: 860px; font-size: clamp(22px, 2.4vw, 32px); line-height: 1.4; font-weight: 500; color: #fff; }
.st-cta { display: flex; flex-wrap: wrap; justify-content: space-between; align-items: flex-end; gap: 28px; max-width: 1240px; margin: 0 auto; padding: clamp(56px, 7vw, 96px) var(--pad); border-bottom: 1px solid var(--ln); }
.st-cta h2 { margin: 10px 0 12px; font-family: var(--display); font-weight: 400; text-transform: uppercase; font-size: clamp(32px, 3.6vw, 54px); line-height: 1.1; }
.st-cta p { margin: 0; color: var(--wh2); max-width: 520px; }
.st-cta .btnrow { margin: 0; }
.st-foot { display: flex; flex-wrap: wrap; justify-content: space-between; align-items: center; gap: 16px; max-width: 1240px; margin: 0 auto; padding: 26px var(--pad) 56px; font-size: 12px; font-weight: 600; letter-spacing: .14em; text-transform: uppercase; color: var(--mu); }
.st-ok { display: inline-flex; align-items: center; gap: 8px; color: var(--ok); text-decoration: none; }
.st-ok:hover { color: #fff; }
@media (max-width: 900px) {
  .st-ch { grid-template-columns: minmax(0, 1fr); gap: 18px; }
  .st-ch__h { position: static; }
  .st-ch__big { font-size: 96px; margin-bottom: 16px; }
  .st-rules li { grid-template-columns: 46px minmax(0, 1fr); gap: 12px; padding: 20px 0; }
  .st-index { top: 72px; }
}
@media print {
  .st-index, .st-cta, .st-foot .btn, .lv-edit { display: none !important; }
  .st-page, .st-page * { color: #000 !important; -webkit-text-stroke-color: #999 !important; background: none !important; }
  .st-ch { break-inside: avoid; padding: 24px 0; grid-template-columns: 200px 1fr; }
  .st-ch__h { position: static; }
  .st-close { padding: 20px 0; border-top: 2px solid #000; }
  .st-close::after { display: none; }
}
/* contul de membru: Standardele ATPR */
.std-box { border-left: 3px solid var(--red); }
.std-box.is-ok { border-left-color: var(--ok); }
.std-done { display: flex; gap: 10px; align-items: baseline; font-size: 17px; color: #fff; margin: 0 0 6px; }
.std-done span { color: var(--ok); font-weight: 700; }
.std-accept { margin-top: 14px; }
.std-accept .ck span small { display: inline; }
.spec .st-ok { display: inline-block; margin-top: 8px; font-size: 13px; font-weight: 600; }

/* ---------- pagini noi fara antet: incep direct cu primul bloc ---------- */
.sr-only { position: absolute !important; width: 1px; height: 1px; padding: 0; margin: -1px; overflow: hidden; clip: rect(0 0 0 0); white-space: nowrap; border: 0; }
.prose--bare:has(> .b-sec:first-child:not(.b-bg-none)) { padding-top: 0; }
.prose--bare:has(> .b-sec:last-child:not(.b-bg-none)) { padding-bottom: 0; }
.prose--bare > .b-sec:last-child:not(.b-bg-none) { margin-bottom: 0; }